2,3-dihydrorobustaflavone 5-methyl ether

ID: ALA2253313

PubChem CID: 76333670

Max Phase: Preclinical

Molecular Formula: C31H22O10

Molecular Weight: 554.51

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(O)cc2c1C(=O)CC(c1ccc(O)c(-c3c(O)cc4oc(-c5ccc(O)cc5)cc(=O)c4c3O)c1)O2

Standard InChI:  InChI=1S/C31H22O10/c1-39-25-9-17(33)10-26-29(25)21(36)11-24(41-26)15-4-7-19(34)18(8-15)28-20(35)13-27-30(31(28)38)22(37)12-23(40-27)14-2-5-16(32)6-3-14/h2-10,12-13,24,32-35,38H,11H2,1H3

Standard InChI Key:  PENVZGWIOSIDJF-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 41 46  0  0  0  0  0  0  0  0999 V2000
   27.3043   -2.3442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3032   -3.1638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0112   -3.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0094   -1.9354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7181   -2.3406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7169   -3.1658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4270   -3.5772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1428   -3.1679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1440   -2.3427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4293   -1.9268    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.4247   -4.3943    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.5965   -1.9358    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.0109   -4.3899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.8527   -1.9358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5580   -2.3504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2662   -1.9442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2686   -1.1262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5570   -0.7160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8517   -1.1245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9768   -0.7184    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.9727   -2.3549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9673   -3.1708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6730   -3.5814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6764   -1.9465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6750   -1.1293    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.2575   -3.5758    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.3826   -2.3534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3795   -3.1783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0884   -3.5912    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.8050   -3.1837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8081   -2.3588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0947   -1.9413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0966   -1.1241    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.5081   -3.5948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5025   -4.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2072   -4.8252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9180   -4.4202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9197   -3.5988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2143   -3.1903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6241   -4.8316    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.3031   -4.7983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  7 11  2  0
  1 12  1  0
  3 13  1  0
  9 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
 16 21  1  0
 21 22  2  0
 22 23  1  0
 23 28  2  0
 27 24  2  0
 24 21  1  0
 24 25  1  0
 22 26  1  0
 27 28  1  0
 27 32  1  0
 28 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 34  1  0
 30 34  1  0
 37 40  1  0
 13 41  1  0
M  END

Associated Targets(non-human)

Spinacia oleracea (250 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
psaC Photosystem I iron-sulfur center (26 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
psbA Photosystem Q(B) protein (185 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 554.51Molecular Weight (Monoisotopic): 554.1213AlogP: 5.37#Rotatable Bonds: 4
Polar Surface Area: 166.89Molecular Species: ACIDHBA: 10HBD: 5
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: 6.22CX Basic pKa: CX LogP: 4.71CX LogD: 3.23
Aromatic Rings: 5Heavy Atoms: 41QED Weighted: 0.19Np Likeness Score: 1.64

References

1. Aguilar MI, Romero MG, Chávez MI, King-Díaz B, Lotina-Hennsen B..  (2008)  Biflavonoids isolated from Selaginella lepidophylla inhibit photosynthesis in spinach chloroplasts.,  56  (16): [PMID:18646760] [10.1021/jf8010432]

Source