The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 2-(2-(2-(4-cyclohexylbutyl)-1H-benzo[d]imidazol-1-yl)ethoxy)-5-((2,4-dioxothiazolidin-5-yl)methyl)benzoate ID: ALA2260187
PubChem CID: 9850847
Max Phase: Preclinical
Molecular Formula: C31H37N3O5S
Molecular Weight: 563.72
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1cc(CC2SC(=O)NC2=O)ccc1OCCn1c(CCCCC2CCCCC2)nc2ccccc21
Standard InChI: InChI=1S/C31H37N3O5S/c1-38-30(36)23-19-22(20-27-29(35)33-31(37)40-27)15-16-26(23)39-18-17-34-25-13-7-6-12-24(25)32-28(34)14-8-5-11-21-9-3-2-4-10-21/h6-7,12-13,15-16,19,21,27H,2-5,8-11,14,17-18,20H2,1H3,(H,33,35,37)
Standard InChI Key: UWFGMVFEGMUFHY-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
3.6798 -18.0145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8924 -18.2639 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1640 -18.6917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6721 -19.3571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8822 -19.0913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9783 -18.7019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8318 -20.1757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2601 -19.6469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2132 -20.7197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4238 -20.4537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3997 -17.9927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2246 -18.0030 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6461 -17.2938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4696 -17.3072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8909 -16.5988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4873 -15.8783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6581 -15.8705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2406 -16.5795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8716 -18.0276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4487 -18.7360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6965 -18.0397 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0985 -18.7601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9078 -15.1685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7327 -15.1777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2104 -15.8452 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.9979 -15.5991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0070 -14.7741 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2254 -14.5106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9778 -13.7236 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6598 -16.0914 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0665 -17.2860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8910 -17.2569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2781 -16.5285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8407 -15.8289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2278 -15.1004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0525 -15.0711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4396 -14.3467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0057 -13.6446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1802 -13.6718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7886 -14.4009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 1 1 0
4 3 1 0
5 2 1 0
6 3 1 0
7 4 2 0
8 5 2 0
9 7 1 0
10 8 1 0
4 5 1 0
9 10 2 0
6 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
14 19 1 0
19 20 2 0
19 21 1 0
21 22 1 0
16 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 24 1 0
28 29 2 0
26 30 2 0
1 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
35 40 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 563.72Molecular Weight (Monoisotopic): 563.2454AlogP: 6.09#Rotatable Bonds: 12Polar Surface Area: 99.52Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.67CX Basic pKa: 5.68CX LogP: 6.59CX LogD: 6.03Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.21Np Likeness Score: -0.76
References 1. Chittiboyina AG, Mizuno CS, Desai PV, Patny A, Kurtz TW, Pershadsingh HA, Speth RC, Karamyan V, Avery MA. (2009) Design, synthesis, and docking studies of novel telmisartanglitazone hybrid analogs for the treatment of metabolic syndrome, 18 (7): [10.1007/s00044-008-9152-x ]