The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
dimethyl 4'-((1,2'-dimethyl-1H,3'H-2,5'-bibenzo[d]imidazol-3'-yl)methyl)biphenyl-2,4-dicarboxylate ID: ALA2260192
PubChem CID: 76319244
Max Phase: Preclinical
Molecular Formula: C33H28N4O4
Molecular Weight: 544.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1ccc(-c2ccc(Cn3c(C)nc4ccc(-c5nc6ccccc6n5C)cc43)cc2)c(C(=O)OC)c1
Standard InChI: InChI=1S/C33H28N4O4/c1-20-34-28-16-14-23(31-35-27-7-5-6-8-29(27)36(31)2)18-30(28)37(20)19-21-9-11-22(12-10-21)25-15-13-24(32(38)40-3)17-26(25)33(39)41-4/h5-18H,19H2,1-4H3
Standard InChI Key: JMQAFQQADGBTEL-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
25.2490 -9.8063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2478 -10.6258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9559 -11.0348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9541 -9.3974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6627 -9.8027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6630 -10.6258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4459 -10.8800 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.9296 -10.2139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4455 -9.5481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.6987 -11.6571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1520 -12.2646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3545 -12.0935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8081 -12.7001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0607 -13.4782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8647 -13.6462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4076 -13.0383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5154 -14.0848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7150 -13.9146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1694 -14.5220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4230 -15.2997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2273 -15.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7694 -14.8580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5694 -15.0244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8253 -15.8005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.1136 -14.4147 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.2812 -16.4102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8780 -15.9086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0781 -15.7411 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.1328 -16.6851 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.8233 -14.9646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7468 -10.2136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5443 -11.0330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7981 -10.7000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.4582 -11.8456 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.6588 -12.0150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2513 -11.3067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4360 -11.3065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0273 -12.0139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4398 -12.7229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2538 -12.7195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6286 -9.9006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
7 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
14 17 1 0
22 23 1 0
23 24 1 0
23 25 2 0
24 26 1 0
20 27 1 0
27 28 1 0
27 29 2 0
28 30 1 0
8 31 1 0
32 33 1 0
33 36 1 0
35 34 1 0
34 32 2 0
2 32 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
33 41 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 544.61Molecular Weight (Monoisotopic): 544.2111AlogP: 6.19#Rotatable Bonds: 6Polar Surface Area: 88.24Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 5.71CX LogP: 6.52CX LogD: 6.51Aromatic Rings: 6Heavy Atoms: 41QED Weighted: 0.23Np Likeness Score: -0.90
References 1. Mizuno CS, Chittiboyina AG, Patny A, Kurtz TW, Pershadsingh HA, Speth RC, Karamyan VT, Avery MA. (2009) Design, synthesis, and docking studies of telmisartan analogs for the treatment of metabolic syndrome, 18 (8): [10.1007/s00044-008-9153-9 ]