Dimethyl 4'-((1,7'-dimethyl-2'-propyl-1H,3'H-2,5'-bibenzo[d]imidazol-3'-yl)methyl)biphe-nyl-2,4-dicarboxylate

ID: ALA2260198

PubChem CID: 10077050

Max Phase: Preclinical

Molecular Formula: C36H34N4O4

Molecular Weight: 586.69

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCc1nc2c(C)cc(-c3nc4ccccc4n3C)cc2n1Cc1ccc(-c2ccc(C(=O)OC)cc2C(=O)OC)cc1

Standard InChI:  InChI=1S/C36H34N4O4/c1-6-9-32-38-33-22(2)18-26(34-37-29-10-7-8-11-30(29)39(34)3)20-31(33)40(32)21-23-12-14-24(15-13-23)27-17-16-25(35(41)43-4)19-28(27)36(42)44-5/h7-8,10-20H,6,9,21H2,1-5H3

Standard InChI Key:  RTPQEXFSFBAYHB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 44 49  0  0  0  0  0  0  0  0999 V2000
   16.1938   -0.7800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1927   -1.5995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9007   -2.0085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8989   -0.3711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6076   -0.7764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6078   -1.5996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3908   -1.8538    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.8745   -1.1876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3904   -0.5219    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.6435   -2.6309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0969   -3.2383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2993   -3.0673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7529   -3.6739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0055   -4.4520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8096   -4.6200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3525   -4.0120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4602   -5.0585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6598   -4.8884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1142   -5.4957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3678   -6.2735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1721   -6.4404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7142   -5.8317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5143   -5.9982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7702   -6.7742    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.0585   -5.3885    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2260   -7.3839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8228   -6.8824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0230   -6.7148    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0776   -7.6588    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7682   -5.9384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8965    0.4537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6917   -1.1873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1005   -1.8949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6922   -2.6027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4892   -2.0067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7429   -1.6738    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.4031   -2.8193    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.6037   -2.9887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1961   -2.2804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3808   -2.2803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9721   -2.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3847   -3.6966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1986   -3.6933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5735   -0.8743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  7 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 14 17  1  0
 22 23  1  0
 23 24  1  0
 23 25  2  0
 24 26  1  0
 20 27  1  0
 27 28  1  0
 27 29  2  0
 28 30  1  0
  4 31  1  0
  8 32  1  0
 32 33  1  0
 33 34  1  0
 35 36  1  0
 36 39  1  0
 38 37  1  0
 37 35  2  0
  2 35  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 42  1  0
 42 43  2  0
 43 38  1  0
 36 44  1  0
M  END

Associated Targets(Human)

PPARG Tclin Peroxisome proliferator-activated receptor gamma (15191 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Agtr1 Type-1A angiotensin II receptor (520 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
3T3-L1 (3664 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 586.69Molecular Weight (Monoisotopic): 586.2580AlogP: 7.14#Rotatable Bonds: 8
Polar Surface Area: 88.24Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 5.85CX LogP: 8.18CX LogD: 8.17
Aromatic Rings: 6Heavy Atoms: 44QED Weighted: 0.18Np Likeness Score: -0.88

References

1. Mizuno CS, Chittiboyina AG, Patny A, Kurtz TW, Pershadsingh HA, Speth RC, Karamyan VT, Avery MA.  (2009)  Design, synthesis, and docking studies of telmisartan analogs for the treatment of metabolic syndrome,  18  (8): [10.1007/s00044-008-9153-9]

Source