The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Dimethyl 4'-((1,7'-dimethyl-2'-propyl-1H,3'H-2,5'-bibenzo[d]imidazol-3'-yl)methyl)biphe-nyl-2,4-dicarboxylate ID: ALA2260198
PubChem CID: 10077050
Max Phase: Preclinical
Molecular Formula: C36H34N4O4
Molecular Weight: 586.69
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCc1nc2c(C)cc(-c3nc4ccccc4n3C)cc2n1Cc1ccc(-c2ccc(C(=O)OC)cc2C(=O)OC)cc1
Standard InChI: InChI=1S/C36H34N4O4/c1-6-9-32-38-33-22(2)18-26(34-37-29-10-7-8-11-30(29)39(34)3)20-31(33)40(32)21-23-12-14-24(15-13-23)27-17-16-25(35(41)43-4)19-28(27)36(42)44-5/h7-8,10-20H,6,9,21H2,1-5H3
Standard InChI Key: RTPQEXFSFBAYHB-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 49 0 0 0 0 0 0 0 0999 V2000
16.1938 -0.7800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1927 -1.5995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9007 -2.0085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8989 -0.3711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6076 -0.7764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6078 -1.5996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3908 -1.8538 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.8745 -1.1876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3904 -0.5219 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.6435 -2.6309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0969 -3.2383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2993 -3.0673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7529 -3.6739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0055 -4.4520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8096 -4.6200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3525 -4.0120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4602 -5.0585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6598 -4.8884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1142 -5.4957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3678 -6.2735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1721 -6.4404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7142 -5.8317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5143 -5.9982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7702 -6.7742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0585 -5.3885 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2260 -7.3839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8228 -6.8824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0230 -6.7148 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0776 -7.6588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7682 -5.9384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8965 0.4537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6917 -1.1873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1005 -1.8949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6922 -2.6027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4892 -2.0067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7429 -1.6738 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4031 -2.8193 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6037 -2.9887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1961 -2.2804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3808 -2.2803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9721 -2.9876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3847 -3.6966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1986 -3.6933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5735 -0.8743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
7 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
14 17 1 0
22 23 1 0
23 24 1 0
23 25 2 0
24 26 1 0
20 27 1 0
27 28 1 0
27 29 2 0
28 30 1 0
4 31 1 0
8 32 1 0
32 33 1 0
33 34 1 0
35 36 1 0
36 39 1 0
38 37 1 0
37 35 2 0
2 35 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 38 1 0
36 44 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 586.69Molecular Weight (Monoisotopic): 586.2580AlogP: 7.14#Rotatable Bonds: 8Polar Surface Area: 88.24Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 5.85CX LogP: 8.18CX LogD: 8.17Aromatic Rings: 6Heavy Atoms: 44QED Weighted: 0.18Np Likeness Score: -0.88
References 1. Mizuno CS, Chittiboyina AG, Patny A, Kurtz TW, Pershadsingh HA, Speth RC, Karamyan VT, Avery MA. (2009) Design, synthesis, and docking studies of telmisartan analogs for the treatment of metabolic syndrome, 18 (8): [10.1007/s00044-008-9153-9 ]