The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-benzoyl-1,5-diphenyl-1H-pyrazol-3-oyl)-sulfamide ID: ALA2260912
PubChem CID: 76326508
Max Phase: Preclinical
Molecular Formula: C23H18N4O4S
Molecular Weight: 446.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: NS(=O)(=O)NC(=O)c1nn(-c2ccccc2)c(-c2ccccc2)c1C(=O)c1ccccc1
Standard InChI: InChI=1S/C23H18N4O4S/c24-32(30,31)26-23(29)20-19(22(28)17-12-6-2-7-13-17)21(16-10-4-1-5-11-16)27(25-20)18-14-8-3-9-15-18/h1-15H,(H,26,29)(H2,24,30,31)
Standard InChI Key: UEHURQNSYWSSCV-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
15.1521 -3.6821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9806 -3.6730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3851 -2.9536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5781 -4.9494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2417 -4.4581 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9041 -4.4724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5869 -5.7776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8762 -6.1972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8851 -7.0253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6044 -7.4297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3193 -7.0100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3104 -6.1819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1714 -4.8482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1336 -5.6694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4012 -6.0453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7079 -5.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7519 -4.7710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4847 -4.3988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7448 -2.9659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1613 -2.2549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9207 -2.9606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5162 -2.2431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6930 -2.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2756 -2.9489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6874 -3.6676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5094 -3.6697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2091 -2.9441 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9649 -2.2447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6128 -2.2258 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
18.4369 -2.2163 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6046 -1.3983 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8097 -2.0060 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
4 5 1 0
4 6 1 0
1 6 2 0
2 5 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
7 12 2 0
4 7 1 0
6 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
1 19 1 0
19 20 2 0
19 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
3 27 1 0
3 28 2 0
27 29 1 0
29 30 1 0
29 31 2 0
29 32 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.49Molecular Weight (Monoisotopic): 446.1049AlogP: 2.70#Rotatable Bonds: 6Polar Surface Area: 124.15Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.76CX Basic pKa: ┄CX LogP: 3.35CX LogD: 2.41Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.44Np Likeness Score: -0.84
References 1. Bildirici I, Sener A, Tozlu I. (2007) Further derivatives of 4-benzoyl-1,5-diphenyl-1H-pyrazole-3-carboxylic acid and their antibacterial activities, 16 (7): [10.1007/s00044-007-9082-z ]