The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3,4-Dibenzoyl-1,5-diphenyl-1H-pyrazole ID: ALA2260913
PubChem CID: 12321120
Max Phase: Preclinical
Molecular Formula: C29H20N2O2
Molecular Weight: 428.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1ccccc1)c1nn(-c2ccccc2)c(-c2ccccc2)c1C(=O)c1ccccc1
Standard InChI: InChI=1S/C29H20N2O2/c32-28(22-15-7-2-8-16-22)25-26(29(33)23-17-9-3-10-18-23)30-31(24-19-11-4-12-20-24)27(25)21-13-5-1-6-14-21/h1-20H
Standard InChI Key: NYQGRRYTJIZSCD-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
5.9669 -12.0045 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6471 -11.5468 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4169 -10.7595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6000 -10.7324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3233 -11.5018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6182 -11.9170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9028 -11.5191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2026 -11.9285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2095 -12.7481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9174 -13.1525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6250 -12.7365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9395 -12.8214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2156 -13.2073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1897 -14.0281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8861 -14.4590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6100 -14.0772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6359 -13.2565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8572 -10.0696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6772 -10.0981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0570 -10.8258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8733 -10.8562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3136 -10.1663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9338 -9.4386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1174 -9.4082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4773 -9.3419 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1809 -10.0269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5790 -9.3091 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3597 -10.0389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9409 -9.3324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1204 -9.3441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7215 -10.0624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1449 -10.7704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9640 -10.7553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
1 5 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
6 11 2 0
5 6 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
12 17 2 0
1 12 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
19 24 2 0
18 25 2 0
3 18 1 0
4 26 1 0
26 27 2 0
26 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 428.49Molecular Weight (Monoisotopic): 428.1525AlogP: 6.00#Rotatable Bonds: 6Polar Surface Area: 51.96Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.93CX LogD: 6.93Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.31Np Likeness Score: -0.61
References 1. Bildirici I, Sener A, Tozlu I. (2007) Further derivatives of 4-benzoyl-1,5-diphenyl-1H-pyrazole-3-carboxylic acid and their antibacterial activities, 16 (7): [10.1007/s00044-007-9082-z ]