(+)-(S)-2-(2,3-dichlorophenoxy)-N-methyl-1-phenylethanamine Oxalate

ID: ALA2260932

PubChem CID: 76330158

Max Phase: Preclinical

Molecular Formula: C17H17Cl2NO5

Molecular Weight: 296.20

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN[C@H](COc1cccc(Cl)c1Cl)c1ccccc1.O=C(O)C(=O)O

Standard InChI:  InChI=1S/C15H15Cl2NO.C2H2O4/c1-18-13(11-6-3-2-4-7-11)10-19-14-9-5-8-12(16)15(14)17;3-1(4)2(5)6/h2-9,13,18H,10H2,1H3;(H,3,4)(H,5,6)/t13-;/m1./s1

Standard InChI Key:  YDHTUUUEZQVHJR-BTQNPOSSSA-N

Molfile:  

     RDKit          2D

 25 25  0  0  0  0  0  0  0  0999 V2000
   15.1866  -20.8823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9002  -21.2913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4760  -21.2913    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1866  -20.0643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6067  -20.8823    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9002  -22.1128    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6376  -22.8503    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9236  -22.4374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2053  -22.8503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4911  -22.4374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7770  -22.8503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7770  -23.6761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0628  -24.0890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3446  -23.6761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3446  -22.8503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0628  -22.4374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0639  -21.6117    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   14.3461  -22.4335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9221  -21.6145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6394  -21.2031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6407  -20.3781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9256  -19.9635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2075  -20.3799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2096  -21.2035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6299  -22.4368    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  1  4  1  0
  2  5  2  0
  2  6  1  0
  8  9  1  0
  7  8  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 11 16  2  0
 10 11  1  0
  9 10  1  0
 16 17  1  0
  7 18  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
  8 19  1  6
 15 25  1  0
M  END

Associated Targets(Human)

HTR1D Tclin Serotonin 1d (5-HT1d) receptor (2897 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 296.20Molecular Weight (Monoisotopic): 295.0531AlogP: 4.33#Rotatable Bonds: 5
Polar Surface Area: 21.26Molecular Species: BASEHBA: 2HBD: 1
#RO5 Violations: HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.89CX LogP: 4.44CX LogD: 2.95
Aromatic Rings: 2Heavy Atoms: 19QED Weighted: 0.89Np Likeness Score: -0.85

References

1. Ismaiel AM, Gad LM, Ghareib SA, Bamanie FH, Moustafa MA.  (2009)  Synthesis of aryloxyalkylamines as h5-HT1B agonists with potential analgesic activity,  18  (9): [10.1007/s00044-009-9164-1]

Source