The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(+)-(S)-1-(2-(2,3-dichlorophenoxy)-1-phenylethyl)-4-methylpiperazine Oxalate ID: ALA2260934
PubChem CID: 76312089
Max Phase: Preclinical
Molecular Formula: C21H24Cl2N2O5
Molecular Weight: 365.30
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCN([C@H](COc2cccc(Cl)c2Cl)c2ccccc2)CC1.O=C(O)C(=O)O
Standard InChI: InChI=1S/C19H22Cl2N2O.C2H2O4/c1-22-10-12-23(13-11-22)17(15-6-3-2-4-7-15)14-24-18-9-5-8-16(20)19(18)21;3-1(4)2(5)6/h2-9,17H,10-14H2,1H3;(H,3,4)(H,5,6)/t17-;/m1./s1
Standard InChI Key: WLPOPQWAXLIJCV-UNTBIKODSA-N
Molfile:
RDKit 2D
30 31 0 0 0 0 0 0 0 0999 V2000
31.1959 -21.1146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9093 -21.5235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4854 -21.5235 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.1959 -20.2968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.6157 -21.1146 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.9093 -22.3449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.7556 -22.7213 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.0415 -22.3085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3234 -22.7213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6094 -22.3085 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.8953 -22.7213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8953 -23.5470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1814 -23.9598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4632 -23.5470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4632 -22.7213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1814 -22.3085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1825 -21.4828 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
28.0400 -21.4857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7573 -21.0744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7587 -20.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0435 -19.8349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3257 -20.2512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3279 -21.0748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7486 -22.3079 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
28.7489 -23.5433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4588 -23.9560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1757 -23.5476 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.1782 -22.7219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4638 -22.3046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8889 -23.9635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
2 5 2 0
2 6 1 0
8 9 1 0
7 8 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
11 16 2 0
10 11 1 0
9 10 1 0
16 17 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
8 18 1 6
15 24 1 0
7 25 1 0
7 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
27 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 365.30Molecular Weight (Monoisotopic): 364.1109AlogP: 4.36#Rotatable Bonds: 5Polar Surface Area: 15.71Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.52CX LogP: 4.67CX LogD: 4.31Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.78Np Likeness Score: -1.28
References 1. Ismaiel AM, Gad LM, Ghareib SA, Bamanie FH, Moustafa MA. (2009) Synthesis of aryloxyalkylamines as h5-HT1B agonists with potential analgesic activity, 18 (9): [10.1007/s00044-009-9164-1 ]