bis(7-hydroxybenzo[b]furan-2-yl)methanone

ID: ALA226131

PubChem CID: 13393484

Max Phase: Preclinical

Molecular Formula: C17H10O5

Molecular Weight: 294.26

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(c1cc2cccc(O)c2o1)c1cc2cccc(O)c2o1

Standard InChI:  InChI=1S/C17H10O5/c18-11-5-1-3-9-7-13(21-16(9)11)15(20)14-8-10-4-2-6-12(19)17(10)22-14/h1-8,18-19H

Standard InChI Key:  YJWAGWZPHAIDKY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 22 25  0  0  0  0  0  0  0  0999 V2000
    4.5213  -12.0877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5178  -12.9150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2314  -13.3300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2343  -11.6770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9485  -12.0882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9464  -12.9146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7318  -13.1720    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2193  -12.5046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7352  -11.8348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0443  -12.5067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4550  -13.2222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4586  -11.7933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2776  -11.7111    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1233  -11.0408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7377  -10.4902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4496  -10.9066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1641  -10.4983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1678   -9.6738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4511   -9.2592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7396   -9.6699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8767  -10.9140    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2312  -14.1550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  5  6  1  0
 10 11  2  0
 10 12  1  0
 12 13  1  0
  2  3  1  0
  3  6  2  0
 13 16  1  0
 15 14  1  0
 14 12  2  0
  1  2  2  0
  5  4  2  0
 15 16  2  0
  6  7  1  0
 16 17  1  0
  7  8  1  0
 17 18  2  0
  8  9  2  0
 18 19  1  0
  9  5  1  0
 19 20  2  0
 20 15  1  0
  4  1  1  0
 17 21  1  0
  8 10  1  0
  3 22  1  0
M  END

Alternative Forms

Associated Targets(Human)

FLT3 Tclin Tyrosine-protein kinase receptor FLT3 (13481 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Pdgfrb Platelet-derived growth factor receptor beta (494 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 294.26Molecular Weight (Monoisotopic): 294.0528AlogP: 3.82#Rotatable Bonds: 2
Polar Surface Area: 83.81Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.12CX Basic pKa: CX LogP: 2.98CX LogD: 2.41
Aromatic Rings: 4Heavy Atoms: 22QED Weighted: 0.55Np Likeness Score: 0.09

References

1. Mahboobi S, Uecker A, Cénac C, Sellmer A, Eichhorn E, Elz S, Böhmer FD, Dove S..  (2007)  Inhibition of FLT3 and PDGFR tyrosine kinase activity by bis(benzo[b]furan-2-yl)methanones.,  15  (5): [PMID:17210255] [10.1016/j.bmc.2006.12.011]

Source