2-(4-benzylpiperidin-1-yl)cyclohexyl acetate

ID: ALA2261813

PubChem CID: 76326579

Max Phase: Preclinical

Molecular Formula: C20H29NO2

Molecular Weight: 315.46

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=O)OC1CCCCC1N1CCC(Cc2ccccc2)CC1

Standard InChI:  InChI=1S/C20H29NO2/c1-16(22)23-20-10-6-5-9-19(20)21-13-11-18(12-14-21)15-17-7-3-2-4-8-17/h2-4,7-8,18-20H,5-6,9-15H2,1H3

Standard InChI Key:  FWDJBQGSJBAJPZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
   15.3533  -15.1180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3533  -15.9352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0586  -16.3397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7638  -15.9352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7638  -15.1180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0586  -14.7053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0586  -13.8881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3509  -13.4795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3509  -12.6623    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6432  -13.8881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4696  -14.7124    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.1759  -15.1253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8827  -14.7222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8893  -13.9047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1830  -13.4919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4700  -13.8966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5997  -13.5009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3047  -13.9142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2977  -14.7311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0018  -15.1444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7133  -14.7405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7161  -13.9191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0114  -13.5095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
 11 12  1  0
 11 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
  5 11  1  0
 14 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
M  END

Alternative Forms

Associated Targets(non-human)

Acanthocheilonema viteae (418 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 315.46Molecular Weight (Monoisotopic): 315.2198AlogP: 3.82#Rotatable Bonds: 4
Polar Surface Area: 29.54Molecular Species: BASEHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.51CX LogP: 4.07CX LogD: 1.97
Aromatic Rings: 1Heavy Atoms: 23QED Weighted: 0.79Np Likeness Score: 0.50

References

1. Agarwal A, Awasthi SK, Murthy PK.  (2011)  In vivo antifilarial activity of some cyclic and acylic alcohols,  20  (4): [10.1007/s00044-010-9331-4]

Source