(benzo[b]furan-2-yl)-(1H-indol-2-yl)methanone

ID: ALA226183

PubChem CID: 44423635

Max Phase: Preclinical

Molecular Formula: C17H11NO2

Molecular Weight: 261.28

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(c1cc2ccccc2[nH]1)c1cc2ccccc2o1

Standard InChI:  InChI=1S/C17H11NO2/c19-17(14-9-11-5-1-3-7-13(11)18-14)16-10-12-6-2-4-8-15(12)20-16/h1-10,18H

Standard InChI Key:  NWBGABGOSKEFQJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 20 23  0  0  0  0  0  0  0  0999 V2000
    3.4921  -18.8960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4886  -19.7234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2022  -20.1383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2052  -18.4853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9194  -18.8965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9173  -19.7229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7026  -19.9804    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1902  -19.3130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7060  -18.6432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0152  -19.3150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4259  -20.0305    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4295  -18.6016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2484  -18.5194    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0941  -17.8491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7085  -17.2985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4204  -17.7149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1349  -17.3066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1387  -16.4821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4220  -16.0676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7104  -16.4782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4  1  1  0
  8 10  1  0
  5  6  1  0
 10 11  2  0
 10 12  1  0
 12 13  1  0
  2  3  1  0
  3  6  2  0
 13 16  1  0
 15 14  1  0
 14 12  2  0
  1  2  2  0
  5  4  2  0
 15 16  2  0
  6  7  1  0
 16 17  1  0
  7  8  1  0
 17 18  2  0
  8  9  2  0
 18 19  1  0
  9  5  1  0
 19 20  2  0
 20 15  1  0
M  END

Alternative Forms

Associated Targets(Human)

FLT3 Tclin Tyrosine-protein kinase receptor FLT3 (13481 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Pdgfrb Platelet-derived growth factor receptor beta (494 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 261.28Molecular Weight (Monoisotopic): 261.0790AlogP: 4.15#Rotatable Bonds: 2
Polar Surface Area: 46.00Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.12CX Basic pKa: CX LogP: 3.53CX LogD: 3.53
Aromatic Rings: 4Heavy Atoms: 20QED Weighted: 0.55Np Likeness Score: -0.57

References

1. Mahboobi S, Uecker A, Cénac C, Sellmer A, Eichhorn E, Elz S, Böhmer FD, Dove S..  (2007)  Inhibition of FLT3 and PDGFR tyrosine kinase activity by bis(benzo[b]furan-2-yl)methanones.,  15  (5): [PMID:17210255] [10.1016/j.bmc.2006.12.011]

Source