2-Methoxy-4-methylphenyl 1-(2-(3-benzoylphenyl)propanoyl)pyrrolidine-2-carboxylate

ID: ALA2262368

PubChem CID: 76326628

Max Phase: Preclinical

Molecular Formula: C29H29NO5

Molecular Weight: 471.55

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COc1cc(C)ccc1OC(=O)C1CCCN1C(=O)C(C)c1cccc(C(=O)c2ccccc2)c1

Standard InChI:  InChI=1S/C29H29NO5/c1-19-14-15-25(26(17-19)34-3)35-29(33)24-13-8-16-30(24)28(32)20(2)22-11-7-12-23(18-22)27(31)21-9-5-4-6-10-21/h4-7,9-12,14-15,17-18,20,24H,8,13,16H2,1-3H3

Standard InChI Key:  SIBWBLBVXFIQIE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   19.3395  -27.8132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.1600  -27.8994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3315  -28.7064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6171  -29.1189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0040  -28.5669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7121  -27.2863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5190  -27.4578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.4164  -26.5161    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.9270  -27.0987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1020  -27.0987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6895  -26.3842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3395  -26.3842    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6895  -27.8132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8645  -27.8132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4520  -28.5276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8645  -29.2421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6895  -29.2421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1020  -28.5276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6270  -28.5276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2145  -27.8132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6270  -27.0987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2145  -26.3842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3895  -26.3842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9770  -27.0987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3895  -27.8132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2145  -29.2421    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9356  -25.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6399  -25.1048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1591  -24.4636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9740  -24.5927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2696  -25.3629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7504  -26.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4932  -23.9515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8251  -24.9757    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.5294  -24.2055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  1  5  1  0
  6  7  2  0
  6  8  1  0
  2  6  1  0
  9 10  1  0
 10 11  1  0
  9 12  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 13 18  2  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 20 25  2  0
 19 26  2  0
 15 19  1  0
 10 13  1  0
  1  9  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 27 32  2  0
 30 33  1  0
 34 35  1  0
 28 34  1  0
  8 27  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA2262368

   (2-Methoxy-4-methylphenyl) 1-[2-(3-benzoylphenyl)propanoyl]pyrrolidine-2-carboxylate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 471.55

Molecular Weight (Monoisotopic): 471.2046

AlogP: 4.93

#Rotatable Bonds: 7

Polar Surface Area: 72.91

Molecular Species: NEUTRAL

HBA: 5

HBD: ┄

#RO5 Violations: ┄

HBA (Lipinski): 6

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 5.51

CX LogD: 5.51

Aromatic Rings: 3

Heavy Atoms: 35

QED Weighted: 0.28

Np Likeness Score: -0.58

References

1. Doulgkeris CM, Siskou IC, Xanthopoulou N, Lagouri V, Kravaritou C, Eleftheriou P, Kourounakis PN, Rekka EA.  (2012)  Compounds against inflammation and oxidative insult as potential agents for neurodegenerative disorders,  21  (9): [10.1007/s00044-011-9726-x]

Source

Source(1):

• Scientific Literature