3-methyl-N-phenyl-4-(2-(pyridin-3-ylmethylamino)ethoxy)benzofuran-2-carboxamide

ID: ALA2262490

PubChem CID: 76319451

Max Phase: Preclinical

Molecular Formula: C24H23N3O3

Molecular Weight: 401.47

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1c(C(=O)Nc2ccccc2)oc2cccc(OCCNCc3cccnc3)c12

Standard InChI:  InChI=1S/C24H23N3O3/c1-17-22-20(29-14-13-26-16-18-7-6-12-25-15-18)10-5-11-21(22)30-23(17)24(28)27-19-8-3-2-4-9-19/h2-12,15,26H,13-14,16H2,1H3,(H,27,28)

Standard InChI Key:  WGWGMWGBTUVYLE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   12.5775  -11.5434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6254   -8.8192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3564  -12.2567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9229  -10.0464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4181  -11.5258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9452  -11.5514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2182  -11.2741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2193  -10.4551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1724  -12.2525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9247  -11.6829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9204   -9.2296    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6655   -9.4156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1606  -10.8372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3320   -7.5919    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6301  -10.4514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6230   -8.0025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6326  -11.2763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8994  -10.8569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4131  -10.1928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1286  -11.5560    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7161  -10.8522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1204  -10.1396    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3461  -10.8451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0403   -7.9996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7474   -7.5901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4557   -7.9997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1624   -7.5908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1617   -6.7728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4485   -6.3653    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7448   -6.7765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 18 19  2  0
  9  1  2  0
 19 15  1  0
 15 17  1  0
 17  5  1  0
 11  2  1  0
 16 14  1  0
  3  9  1  0
 18 21  1  0
 23  6  1  0
 21 22  2  0
  6  3  2  0
 21 20  1  0
  5 18  1  0
  1 13  1  0
  4 11  1  0
 15  4  2  0
 13 23  2  0
 10 17  2  0
  4  8  1  0
 20  6  1  0
  2 16  1  0
  8  7  2  0
 19 12  1  0
  7 10  1  0
 14 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
M  END

Associated Targets(non-human)

NMT1 Peptide N-myristoyltransferase 1 (193 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 401.47Molecular Weight (Monoisotopic): 401.1739AlogP: 4.56#Rotatable Bonds: 8
Polar Surface Area: 76.39Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.47CX LogP: 3.64CX LogD: 2.54
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.42Np Likeness Score: -1.27

References

1. Deokar HS, Puranik P, Kulkarni VM.  (2009)  QSAR analysis of N-myristoyltransferase inhibitors: antifungal activity of benzofurans,  18  (3): [10.1007/s00044-008-9120-5]

Source