3,6-Dimethyl-9-(3-trifluoromethyl-4-fluorophenyl)-3,4,6,7-tetrahydroacridine-1,8-(2H,5H,9H,10H)-dione

ID: ALA2263265

PubChem CID: 76326697

Max Phase: Preclinical

Molecular Formula: C22H21F4NO2

Molecular Weight: 407.41

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1CC(=O)C2=C(C1)NC1=C(C(=O)CC(C)C1)C2c1ccc(F)c(C(F)(F)F)c1

Standard InChI:  InChI=1S/C22H21F4NO2/c1-10-5-15-20(17(28)7-10)19(21-16(27-15)6-11(2)8-18(21)29)12-3-4-14(23)13(9-12)22(24,25)26/h3-4,9-11,19,27H,5-8H2,1-2H3

Standard InChI Key:  SXENUVWNHXEBBV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    2.7193   -3.9663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7193   -4.7921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4320   -5.2009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4320   -3.5493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1447   -3.9663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1458   -4.7921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8575   -5.2018    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8554   -3.5502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5717   -3.9645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5720   -4.7877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2812   -5.1969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9945   -4.7872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9943   -3.9640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2806   -3.5504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2791   -2.7246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4320   -2.7235    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7092   -5.2009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0047   -5.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8544   -2.7285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5701   -2.3143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5682   -1.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8514   -1.0774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1350   -1.4967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1404   -2.3204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4104   -1.0843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6910   -1.5057    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.4053   -0.2507    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.6884   -0.6675    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.8481   -0.2437    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  2  0
  5  8  1  0
  6  7  1  0
  7 10  1  0
  9  8  1  0
  9 10  2  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
  4 16  2  0
 12 17  1  0
  2 18  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
  8 19  1  0
 23 25  1  0
 25 26  1  0
 25 27  1  0
 25 28  1  0
 22 29  1  0
M  END

Associated Targets(non-human)

channel Potassium channel protein (61 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 407.41Molecular Weight (Monoisotopic): 407.1508AlogP: 5.04#Rotatable Bonds: 1
Polar Surface Area: 46.17Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.00CX LogD: 4.00
Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.66Np Likeness Score: -0.76

References

1. Gozde Gunduz M, Evrim Dogan A, Simsek R, Erol K, Safak C.  (2009)  Substituted 9-aryl-1,8-acridinedione derivatives and their effects on potassium channels,  18  (4): [10.1007/s00044-008-9129-9]

Source