The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Benzoyl-1-(4-isopropoxycarbonyl-phenyl)-5-phenyl-1H-pyrazole-3-carboxylicacid isopropyl ester ID: ALA2263269
PubChem CID: 76308586
Max Phase: Preclinical
Molecular Formula: C30H28N2O3
Molecular Weight: 464.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C(=O)c1ccc(-n2nc(C(=O)C(C)C)c(C(=O)c3ccccc3)c2-c2ccccc2)cc1
Standard InChI: InChI=1S/C30H28N2O3/c1-19(2)28(33)23-15-17-24(18-16-23)32-27(21-11-7-5-8-12-21)25(26(31-32)29(34)20(3)4)30(35)22-13-9-6-10-14-22/h5-20H,1-4H3
Standard InChI Key: DEEXSJJFRWDYLQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
25.2398 -5.1830 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.8888 -4.6940 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.6260 -3.9271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8260 -3.9272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5765 -4.7170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2003 -3.3538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1273 -2.5431 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.9617 -3.6305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8701 -5.1244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1679 -4.7152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4650 -5.1232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4644 -5.9363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1666 -6.3413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8695 -5.9374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2557 -5.9946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5591 -6.4130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5702 -7.2279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2829 -7.6210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9795 -7.2026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9635 -6.3910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2988 -8.4326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6252 -8.8869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.0292 -8.7891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9627 -3.3218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9753 -2.4915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6794 -2.0881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6782 -1.2744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9765 -0.8685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2724 -1.2719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2695 -2.0853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2399 -3.6563 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.0860 -9.6043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7068 -8.3323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1040 -4.4352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5875 -3.1049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
1 5 1 0
6 7 2 0
6 8 1 0
3 6 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
9 14 2 0
5 9 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
15 20 2 0
21 22 2 0
21 23 1 0
18 21 1 0
1 15 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
25 30 2 0
24 31 2 0
4 24 1 0
23 32 1 0
23 33 1 0
8 34 1 0
8 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.57Molecular Weight (Monoisotopic): 464.2100AlogP: 6.45#Rotatable Bonds: 8Polar Surface Area: 69.03Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 7.07CX LogD: 7.07Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.28Np Likeness Score: -0.53
References 1. Bildirici I, Sener A, Atalan E, Battal A, Genc H. (2009) Synthesis and antibacterial activity of 4-benzoyl-1-(4-carboxy-phenyl)-5-phenyl-1H-pyrazole-3-carboxylic acid and derivatives, 18 (5): [10.1007/s00044-008-9130-3 ]