The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Benzoyl-1-(4-ethoxycarbonyl-phenyl)-5-phenyl-1H-pyrazole-3-carboxylic acid ethyl ester ID: ALA2263271
PubChem CID: 76330367
Max Phase: Preclinical
Molecular Formula: C28H24N2O3
Molecular Weight: 436.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCC(=O)c1ccc(-n2nc(C(=O)CC)c(C(=O)c3ccccc3)c2-c2ccccc2)cc1
Standard InChI: InChI=1S/C28H24N2O3/c1-3-23(31)19-15-17-22(18-16-19)30-27(20-11-7-5-8-12-20)25(26(29-30)24(32)4-2)28(33)21-13-9-6-10-14-21/h5-18H,3-4H2,1-2H3
Standard InChI Key: LZDMGIHXYCGWHT-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
9.5398 -14.1267 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1889 -13.6377 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9260 -12.8708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1261 -12.8709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8765 -13.6607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5003 -12.2975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4273 -11.4869 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2617 -12.5742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1702 -14.0681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4680 -13.6589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7651 -14.0669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7644 -14.8800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4666 -15.2850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1695 -14.8812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5558 -14.9383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8591 -15.3567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8702 -16.1716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5829 -16.5647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2795 -16.1463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2636 -15.3347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5988 -17.3763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9252 -17.8306 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3292 -17.7328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2627 -12.2655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2753 -11.4352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9795 -11.0318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9782 -10.2181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2765 -9.8122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5724 -10.2156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5695 -11.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5399 -12.6000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8875 -12.0486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0069 -17.2760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
1 5 1 0
6 7 2 0
6 8 1 0
3 6 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
9 14 2 0
5 9 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
15 20 2 0
21 22 2 0
21 23 1 0
18 21 1 0
1 15 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
25 30 2 0
24 31 2 0
4 24 1 0
8 32 1 0
23 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 436.51Molecular Weight (Monoisotopic): 436.1787AlogP: 5.96#Rotatable Bonds: 8Polar Surface Area: 69.03Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.99CX LogD: 5.99Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.32Np Likeness Score: -0.70
References 1. Bildirici I, Sener A, Atalan E, Battal A, Genc H. (2009) Synthesis and antibacterial activity of 4-benzoyl-1-(4-carboxy-phenyl)-5-phenyl-1H-pyrazole-3-carboxylic acid and derivatives, 18 (5): [10.1007/s00044-008-9130-3 ]