The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Benzoyl-1-(4-ethylcarbamoyl-phenyl)-5-phenyl-1H-pyrazole-3-carboxylic acid ethylamide ID: ALA2263273
PubChem CID: 76319520
Max Phase: Preclinical
Molecular Formula: C28H26N4O3
Molecular Weight: 466.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCNC(=O)c1ccc(-n2nc(C(=O)NCC)c(C(=O)c3ccccc3)c2-c2ccccc2)cc1
Standard InChI: InChI=1S/C28H26N4O3/c1-3-29-27(34)21-15-17-22(18-16-21)32-25(19-11-7-5-8-12-19)23(24(31-32)28(35)30-4-2)26(33)20-13-9-6-10-14-20/h5-18H,3-4H2,1-2H3,(H,29,34)(H,30,35)
Standard InChI Key: IDIULWCRYVQAEN-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
19.8661 -14.5064 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.5152 -14.0174 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2523 -13.2505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4524 -13.2506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2029 -14.0404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8266 -12.6772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7536 -11.8666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.5881 -12.9539 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.4965 -14.4478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7943 -14.0386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0914 -14.4466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0907 -15.2597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7929 -15.6647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4958 -15.2609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8821 -15.3180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1854 -15.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1966 -16.5513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9092 -16.9444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6059 -16.5260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5899 -15.7144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9252 -17.7560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2515 -18.2103 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.6556 -18.1125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.5890 -12.6452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6016 -11.8149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3058 -11.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3045 -10.5978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6029 -10.1920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8987 -10.5953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8959 -11.4087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8663 -12.9797 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7304 -13.7586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4984 -14.0378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7123 -18.9277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4467 -19.2862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
1 5 1 0
6 7 2 0
6 8 1 0
3 6 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
9 14 2 0
5 9 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
15 20 2 0
21 22 2 0
21 23 1 0
18 21 1 0
1 15 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
25 30 2 0
24 31 2 0
4 24 1 0
8 32 1 0
32 33 1 0
23 34 1 0
34 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 466.54Molecular Weight (Monoisotopic): 466.2005AlogP: 4.27#Rotatable Bonds: 8Polar Surface Area: 93.09Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.69CX Basic pKa: ┄CX LogP: 4.33CX LogD: 4.33Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.38Np Likeness Score: -0.99
References 1. Bildirici I, Sener A, Atalan E, Battal A, Genc H. (2009) Synthesis and antibacterial activity of 4-benzoyl-1-(4-carboxy-phenyl)-5-phenyl-1H-pyrazole-3-carboxylic acid and derivatives, 18 (5): [10.1007/s00044-008-9130-3 ]