The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Benzoyl-1-(4-diethylcarbamoyl-phenyl)-5-phenyl-1H-pyrazole-3-carboxylic acid diethylamide ID: ALA2263274
PubChem CID: 76319521
Max Phase: Preclinical
Molecular Formula: C32H34N4O3
Molecular Weight: 522.65
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)C(=O)c1ccc(-n2nc(C(=O)N(CC)CC)c(C(=O)c3ccccc3)c2-c2ccccc2)cc1
Standard InChI: InChI=1S/C32H34N4O3/c1-5-34(6-2)31(38)25-19-21-26(22-20-25)36-29(23-15-11-9-12-16-23)27(30(37)24-17-13-10-14-18-24)28(33-36)32(39)35(7-3)8-4/h9-22H,5-8H2,1-4H3
Standard InChI Key: NVGOQUDLZQOQEB-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
26.5068 -14.0772 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.1559 -13.5882 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.8930 -12.8213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0931 -12.8213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8436 -13.6112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4673 -12.2479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3943 -11.4373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.2288 -12.5247 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.1372 -14.0186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4350 -13.6094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7321 -14.0174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7314 -14.8305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4336 -15.2355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1365 -14.8316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5228 -14.8888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8261 -15.3072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8373 -16.1221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5499 -16.5152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2466 -16.0967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2306 -15.2852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5659 -17.3268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8922 -17.7811 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.2963 -17.6833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.2297 -12.2160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2423 -11.3857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9465 -10.9823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9453 -10.1686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2436 -9.7627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5394 -10.1661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5366 -10.9795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5070 -12.5505 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.3711 -13.3294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1391 -13.6085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3531 -18.4985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0874 -18.8570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9739 -17.2265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7083 -17.5850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8545 -11.9991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6226 -12.2782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
1 5 1 0
6 7 2 0
6 8 1 0
3 6 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
9 14 2 0
5 9 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
15 20 2 0
21 22 2 0
21 23 1 0
18 21 1 0
1 15 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
25 30 2 0
24 31 2 0
4 24 1 0
8 32 1 0
32 33 1 0
23 34 1 0
34 35 1 0
23 36 1 0
36 37 1 0
8 38 1 0
38 39 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 522.65Molecular Weight (Monoisotopic): 522.2631AlogP: 5.73#Rotatable Bonds: 10Polar Surface Area: 75.51Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.49CX LogD: 5.49Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.25Np Likeness Score: -1.01
References 1. Bildirici I, Sener A, Atalan E, Battal A, Genc H. (2009) Synthesis and antibacterial activity of 4-benzoyl-1-(4-carboxy-phenyl)-5-phenyl-1H-pyrazole-3-carboxylic acid and derivatives, 18 (5): [10.1007/s00044-008-9130-3 ]