The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-{4-[4-Benzoyl-3-(3-phenyl-ureidocarbonyl)-5-phenyl-pyrazol-1-yl]-benzoyl}-3-phenyl-urea ID: ALA2263278
PubChem CID: 76323135
Max Phase: Preclinical
Molecular Formula: C38H28N6O5
Molecular Weight: 648.68
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NC(=O)c1ccc(-n2nc(C(=O)NC(=O)Nc3ccccc3)c(C(=O)c3ccccc3)c2-c2ccccc2)cc1)Nc1ccccc1
Standard InChI: InChI=1S/C38H28N6O5/c45-34(26-15-7-2-8-16-26)31-32(36(47)42-38(49)40-29-19-11-4-12-20-29)43-44(33(31)25-13-5-1-6-14-25)30-23-21-27(22-24-30)35(46)41-37(48)39-28-17-9-3-10-18-28/h1-24H,(H2,39,41,46,48)(H2,40,42,47,49)
Standard InChI Key: JHMINSZHRQCZJN-UHFFFAOYSA-N
Molfile:
RDKit 2D
49 54 0 0 0 0 0 0 0 0999 V2000
25.0623 -24.1930 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.7114 -23.7040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.4485 -22.9371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6486 -22.9372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3990 -23.7270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0747 -22.4212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0794 -21.6073 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.8066 -22.7690 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.6927 -24.1344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9905 -23.7252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2876 -24.1332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2869 -24.9463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9891 -25.3513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6920 -24.9475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0783 -25.0046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3816 -25.4231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3927 -26.2379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1054 -26.6310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8021 -26.2126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7861 -25.4010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1214 -27.4426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4477 -27.8969 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.8333 -27.8347 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.7852 -22.3319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7978 -21.5015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5020 -21.0981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5007 -20.2844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7991 -19.8786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0949 -20.2819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0920 -21.0953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0624 -22.6663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7985 -23.5866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5024 -24.0017 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.8500 -28.6518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5658 -29.0459 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.2138 -23.5997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2651 -28.6229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1507 -29.0747 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.0870 -23.9886 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.9170 -24.0178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6280 -23.6164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6360 -22.7984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9271 -22.3834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2191 -22.7871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9797 -29.0202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6785 -28.5980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6623 -27.7801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9414 -27.3862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2456 -27.8108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
1 5 1 0
6 7 2 0
6 8 1 0
3 6 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
9 14 2 0
5 9 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
15 20 2 0
21 22 2 0
21 23 1 0
18 21 1 0
1 15 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
25 30 2 0
24 31 2 0
4 24 1 0
8 32 1 0
32 33 1 0
23 34 1 0
34 35 1 0
33 36 1 0
35 37 1 0
34 38 2 0
32 39 2 0
36 40 2 0
40 41 1 0
41 42 2 0
42 43 1 0
43 44 2 0
44 36 1 0
37 45 2 0
45 46 1 0
46 47 2 0
47 48 1 0
48 49 2 0
49 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 648.68Molecular Weight (Monoisotopic): 648.2121AlogP: 6.69#Rotatable Bonds: 8Polar Surface Area: 151.29Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 3CX Acidic pKa: 10.12CX Basic pKa: ┄CX LogP: 6.97CX LogD: 6.96Aromatic Rings: 6Heavy Atoms: 49QED Weighted: 0.14Np Likeness Score: -0.92
References 1. Bildirici I, Sener A, Atalan E, Battal A, Genc H. (2009) Synthesis and antibacterial activity of 4-benzoyl-1-(4-carboxy-phenyl)-5-phenyl-1H-pyrazole-3-carboxylic acid and derivatives, 18 (5): [10.1007/s00044-008-9130-3 ]