The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Benzoyl-1-(4-cyano-phenyl)-5-phenyl-1H-pyrazole-3-carbonitrile ID: ALA2263279
PubChem CID: 76326699
Max Phase: Preclinical
Molecular Formula: C24H14N4O
Molecular Weight: 374.40
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1ccc(-n2nc(C#N)c(C(=O)c3ccccc3)c2-c2ccccc2)cc1
Standard InChI: InChI=1S/C24H14N4O/c25-15-17-11-13-20(14-12-17)28-23(18-7-3-1-4-8-18)22(21(16-26)27-28)24(29)19-9-5-2-6-10-19/h1-14H
Standard InChI Key: GXZUTJYFMCYXGX-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
2.6845 -4.6052 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3335 -4.1162 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0707 -3.3493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2707 -3.3493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0212 -4.1392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6969 -2.8334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3148 -4.5466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6126 -4.1374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0913 -4.5454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0989 -5.3585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6113 -5.7635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3142 -5.3596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7004 -5.4168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0038 -5.8352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0149 -6.6501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7275 -7.0432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4242 -6.6248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4082 -5.8132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7435 -7.8548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4074 -2.7440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4200 -1.9137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1241 -1.5103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1229 -0.6966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4212 -0.2907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7171 -0.6941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7142 -1.5075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6846 -3.0785 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3191 -2.3178 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7603 -8.6676 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
1 5 1 0
3 6 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
7 12 2 0
5 7 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
13 18 2 0
16 19 1 0
1 13 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
21 26 2 0
20 27 2 0
4 20 1 0
6 28 3 0
19 29 3 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 374.40Molecular Weight (Monoisotopic): 374.1168AlogP: 4.51#Rotatable Bonds: 4Polar Surface Area: 82.47Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.18CX LogD: 5.18Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.49Np Likeness Score: -1.13
References 1. Bildirici I, Sener A, Atalan E, Battal A, Genc H. (2009) Synthesis and antibacterial activity of 4-benzoyl-1-(4-carboxy-phenyl)-5-phenyl-1H-pyrazole-3-carboxylic acid and derivatives, 18 (5): [10.1007/s00044-008-9130-3 ]