The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(7-Oxo-3,4,6-triphenyl-6,7-dihydro-pyrazolo[3,4-d]pyridazin-2-yl)-benzoic acid ID: ALA2263280
PubChem CID: 76308587
Max Phase: Preclinical
Molecular Formula: C24H16N4O3
Molecular Weight: 408.42
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1ccc(-n2nc3c(=O)[nH]nc(-c4ccccc4)c3c2-c2ccccc2)cc1
Standard InChI: InChI=1S/C24H16N4O3/c29-23-21-19(20(25-26-23)15-7-3-1-4-8-15)22(16-9-5-2-6-10-16)28(27-21)18-13-11-17(12-14-18)24(30)31/h1-14H,(H,26,29)(H,30,31)
Standard InChI Key: MFQSSISUFCNPAE-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
9.6678 -2.1481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2615 -1.4398 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4443 -1.4398 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0335 -2.1481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2207 -2.1503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8117 -1.4415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9953 -1.4423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5868 -2.1511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0008 -2.8606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8159 -2.8564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4850 -2.1492 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2615 -2.8519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4443 -2.8519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1918 -3.6290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8529 -4.1094 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5139 -3.6291 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8547 -4.9240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1453 -5.3320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1450 -6.1484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8532 -6.5578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5633 -6.1449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5601 -5.3298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8532 -7.3778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1460 -7.7873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5614 -7.7855 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4183 -3.8802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8111 -3.3316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0345 -3.5835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8639 -4.3836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4761 -4.9313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2503 -4.6765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13 4 1 0
12 1 1 0
1 2 1 0
2 3 1 0
3 4 2 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
4 5 1 0
1 11 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 12 2 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
15 17 1 0
23 24 1 0
23 25 2 0
20 23 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
14 26 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 408.42Molecular Weight (Monoisotopic): 408.1222AlogP: 4.14#Rotatable Bonds: 4Polar Surface Area: 100.87Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.52CX Basic pKa: ┄CX LogP: 4.43CX LogD: 1.63Aromatic Rings: 5Heavy Atoms: 31QED Weighted: 0.47Np Likeness Score: -0.92
References 1. Bildirici I, Sener A, Atalan E, Battal A, Genc H. (2009) Synthesis and antibacterial activity of 4-benzoyl-1-(4-carboxy-phenyl)-5-phenyl-1H-pyrazole-3-carboxylic acid and derivatives, 18 (5): [10.1007/s00044-008-9130-3 ]