The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(7-Oxo-3,4-diphenyl-6,7-dihydro-pyrazolo[3,4-d]pyridazin-2-yl)-benzoic acid ID: ALA2263283
PubChem CID: 76333961
Max Phase: Preclinical
Molecular Formula: C31H20N4O5
Molecular Weight: 528.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1ccc(-n2nc3c(=O)n(-c4ccc(C(=O)O)cc4)nc(-c4ccccc4)c3c2-c2ccccc2)cc1
Standard InChI: InChI=1S/C31H20N4O5/c36-29-27-25(26(19-7-3-1-4-8-19)32-35(29)24-17-13-22(14-18-24)31(39)40)28(20-9-5-2-6-10-20)34(33-27)23-15-11-21(12-16-23)30(37)38/h1-18H,(H,37,38)(H,39,40)
Standard InChI Key: OLENAZCQQGXHEU-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
27.3530 -4.7029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9467 -3.9946 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.1295 -3.9946 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.7186 -4.7029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9058 -4.7051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4969 -3.9963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6804 -3.9971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2720 -4.7059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6860 -5.4154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5011 -5.4111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1702 -4.7040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.9467 -5.4067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1295 -5.4066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8769 -6.1838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5380 -6.6642 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.1991 -6.1838 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.5398 -7.4788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8305 -7.8867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8302 -8.7032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5384 -9.1126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2485 -8.6996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2453 -7.8845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5383 -9.9326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8312 -10.3421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.2466 -10.3402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.1035 -6.4350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4963 -5.8864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7197 -6.1383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5491 -6.9384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1612 -7.4861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9355 -7.2313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3562 -3.2874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1765 -3.2923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5860 -2.5860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1783 -1.8767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3569 -1.8782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9511 -2.5851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5873 -1.1681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4045 -1.1681 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.1787 -0.4603 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13 4 1 0
12 1 1 0
1 2 1 0
2 3 1 0
3 4 2 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
4 5 1 0
1 11 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 12 2 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
15 17 1 0
23 24 1 0
23 25 2 0
20 23 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
14 26 1 0
2 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
38 39 1 0
38 40 2 0
35 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 528.52Molecular Weight (Monoisotopic): 528.1434AlogP: 5.30#Rotatable Bonds: 6Polar Surface Area: 127.31Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.87CX Basic pKa: ┄CX LogP: 5.97CX LogD: 0.00Aromatic Rings: 6Heavy Atoms: 40QED Weighted: 0.30Np Likeness Score: -0.65
References 1. Bildirici I, Sener A, Atalan E, Battal A, Genc H. (2009) Synthesis and antibacterial activity of 4-benzoyl-1-(4-carboxy-phenyl)-5-phenyl-1H-pyrazole-3-carboxylic acid and derivatives, 18 (5): [10.1007/s00044-008-9130-3 ]