The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-[(4-Carboxy-phenyl-hydrazono)-phenyl-methyl]-4-hydroxy-2-(4-carboxy-phenyl)-6-phenyl-2H-Pyridazin-3-one ID: ALA2263285
PubChem CID: 136244975
Max Phase: Preclinical
Molecular Formula: C31H22N4O6
Molecular Weight: 546.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1ccc(N/N=C(\c2ccccc2)c2c(-c3ccccc3)nn(-c3ccc(C(=O)O)cc3)c(=O)c2O)cc1
Standard InChI: InChI=1S/C31H22N4O6/c36-28-25(26(19-7-3-1-4-8-19)33-32-23-15-11-21(12-16-23)30(38)39)27(20-9-5-2-6-10-20)34-35(29(28)37)24-17-13-22(14-18-24)31(40)41/h1-18,32,36H,(H,38,39)(H,40,41)/b33-26+
Standard InChI Key: RCLLJWIXWIOBDG-MHTZHOPKSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
7.7082 -5.6749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7071 -6.4944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4151 -6.9034 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1248 -6.4940 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1220 -5.6713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4134 -5.2660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8332 -6.9014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8296 -7.7190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5371 -8.1264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2452 -7.7166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2412 -6.8952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5331 -6.4915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9548 -8.1235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9572 -8.9406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6613 -7.7128 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8281 -5.2600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4109 -4.4489 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0004 -5.2665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0002 -4.4493 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2928 -5.6752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5851 -5.2651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8780 -5.6732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8778 -6.4912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5905 -6.8995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2948 -6.4891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2924 -4.0409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2922 -3.2237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0031 -2.8189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0032 -2.0025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2949 -1.5933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5849 -2.0064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5883 -2.8215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2901 -0.7777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9972 -0.3680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5818 -0.3702 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2928 -7.1979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4754 -7.1881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0612 -7.8907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4633 -8.6022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2839 -8.6066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6944 -7.9034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 1 0
6 1 2 0
4 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
13 14 1 0
13 15 2 0
10 13 1 0
5 16 2 0
6 17 1 0
1 18 1 0
18 19 2 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
19 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
33 34 1 0
33 35 2 0
30 33 1 0
2 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 546.54Molecular Weight (Monoisotopic): 546.1539AlogP: 4.87#Rotatable Bonds: 8Polar Surface Area: 154.11Molecular Species: ACIDHBA: 8HBD: 4#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.91CX Basic pKa: 3.17CX LogP: 5.16CX LogD: -2.71Aromatic Rings: 5Heavy Atoms: 41QED Weighted: 0.16Np Likeness Score: -0.74
References 1. Bildirici I, Sener A, Atalan E, Battal A, Genc H. (2009) Synthesis and antibacterial activity of 4-benzoyl-1-(4-carboxy-phenyl)-5-phenyl-1H-pyrazole-3-carboxylic acid and derivatives, 18 (5): [10.1007/s00044-008-9130-3 ]