4-[(3-(4-(2-hydroxyethyl)-1-piperazinyl))propyloxy]phenyl-H-anthra[1,2-d]imidazole-6,11-dione

ID: ALA226865

PubChem CID: 16659186

Max Phase: Preclinical

Molecular Formula: C30H30N4O4

Molecular Weight: 510.59

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1c2ccccc2C(=O)c2c1ccc1nc(-c3ccc(OCCCN4CCN(CCO)CC4)cc3)[nH]c21

Standard InChI:  InChI=1S/C30H30N4O4/c35-18-17-34-15-13-33(14-16-34)12-3-19-38-21-8-6-20(7-9-21)30-31-25-11-10-24-26(27(25)32-30)29(37)23-5-2-1-4-22(23)28(24)36/h1-2,4-11,35H,3,12-19H2,(H,31,32)

Standard InChI Key:  SALVYNDLKIDNSR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 43  0  0  0  0  0  0  0  0999 V2000
   -4.5717   -7.9905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5728   -8.8178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8581   -9.2306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8599   -7.5778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1446   -7.9869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1439   -8.8136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4287   -9.2245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4343   -7.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7185   -7.9800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7149   -8.8095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9959   -9.2192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2800   -8.8007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4387   -6.7480    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4265  -10.0494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3237   -7.4046    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0230   -6.6524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8455   -6.7497    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0072   -7.5621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2846   -7.9668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3801   -5.9327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2059   -5.9258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6090   -5.2070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1872   -4.4970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3582   -4.5105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0412   -5.2298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5894   -3.7768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4142   -3.7650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8368   -4.4734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6616   -4.4615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0842   -5.1699    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6806   -5.8854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0997   -6.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9249   -6.5842    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3293   -5.8641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9084   -5.1516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3449   -7.2942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9400   -8.0128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1151   -8.0215    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  8  5  1  0
 15 16  2  0
 17 18  1  0
 19 15  1  0
  5  4  1  0
 16 20  1  0
  4  1  2  0
 20 21  2  0
  9 10  2  0
 21 22  1  0
 22 23  2  0
 10 11  1  0
 23 24  1  0
  2  3  2  0
 24 25  2  0
 25 20  1  0
 11 12  2  0
 23 26  1  0
 12 19  1  0
 26 27  1  0
 18  9  1  0
 27 28  1  0
  5  6  2  0
 28 29  1  0
  8 13  2  0
 29 30  1  0
 30 31  1  0
  3  6  1  0
  7 14  2  0
 18 19  2  0
  6  7  1  0
  7 10  1  0
 30 35  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 16 17  1  0
 33 36  1  0
  1  2  1  0
 36 37  1  0
  9  8  1  0
 37 38  1  0
M  END

Associated Targets(non-human)

DNA (1199 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TOP1 DNA topoisomerase I (23 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 510.59Molecular Weight (Monoisotopic): 510.2267AlogP: 3.38#Rotatable Bonds: 8
Polar Surface Area: 98.76Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.02CX Basic pKa: 7.87CX LogP: 3.02CX LogD: 2.68
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.31Np Likeness Score: -0.52

References

1. Chaudhuri P, Majumder HK, Bhattacharya S..  (2007)  Synthesis, DNA binding, and Leishmania topoisomerase inhibition activities of a novel series of anthra[1,2-d]imidazole-6,11-dione derivatives.,  50  (10): [PMID:17444624] [10.1021/jm0610604]

Source