The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[(3-(4-(2-hydroxyethyl)-1-piperazinyl))propyloxy]phenyl-H-anthra[1,2-d]imidazole-6,11-dione ID: ALA226865
PubChem CID: 16659186
Max Phase: Preclinical
Molecular Formula: C30H30N4O4
Molecular Weight: 510.59
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C1c2ccccc2C(=O)c2c1ccc1nc(-c3ccc(OCCCN4CCN(CCO)CC4)cc3)[nH]c21
Standard InChI: InChI=1S/C30H30N4O4/c35-18-17-34-15-13-33(14-16-34)12-3-19-38-21-8-6-20(7-9-21)30-31-25-11-10-24-26(27(25)32-30)29(37)23-5-2-1-4-22(23)28(24)36/h1-2,4-11,35H,3,12-19H2,(H,31,32)
Standard InChI Key: SALVYNDLKIDNSR-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
-4.5717 -7.9905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5728 -8.8178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8581 -9.2306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8599 -7.5778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1446 -7.9869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1439 -8.8136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4287 -9.2245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4343 -7.5727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7185 -7.9800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7149 -8.8095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9959 -9.2192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2800 -8.8007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4387 -6.7480 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4265 -10.0494 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3237 -7.4046 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0230 -6.6524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8455 -6.7497 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0072 -7.5621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2846 -7.9668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3801 -5.9327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2059 -5.9258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6090 -5.2070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1872 -4.4970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3582 -4.5105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0412 -5.2298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5894 -3.7768 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4142 -3.7650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8368 -4.4734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6616 -4.4615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0842 -5.1699 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6806 -5.8854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0997 -6.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9249 -6.5842 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3293 -5.8641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9084 -5.1516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3449 -7.2942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9400 -8.0128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1151 -8.0215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8 5 1 0
15 16 2 0
17 18 1 0
19 15 1 0
5 4 1 0
16 20 1 0
4 1 2 0
20 21 2 0
9 10 2 0
21 22 1 0
22 23 2 0
10 11 1 0
23 24 1 0
2 3 2 0
24 25 2 0
25 20 1 0
11 12 2 0
23 26 1 0
12 19 1 0
26 27 1 0
18 9 1 0
27 28 1 0
5 6 2 0
28 29 1 0
8 13 2 0
29 30 1 0
30 31 1 0
3 6 1 0
7 14 2 0
18 19 2 0
6 7 1 0
7 10 1 0
30 35 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
16 17 1 0
33 36 1 0
1 2 1 0
36 37 1 0
9 8 1 0
37 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 510.59Molecular Weight (Monoisotopic): 510.2267AlogP: 3.38#Rotatable Bonds: 8Polar Surface Area: 98.76Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.02CX Basic pKa: 7.87CX LogP: 3.02CX LogD: 2.68Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.31Np Likeness Score: -0.52
References 1. Chaudhuri P, Majumder HK, Bhattacharya S.. (2007) Synthesis, DNA binding, and Leishmania topoisomerase inhibition activities of a novel series of anthra[1,2-d]imidazole-6,11-dione derivatives., 50 (10): [PMID:17444624 ] [10.1021/jm0610604 ]