The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4,4'-(ethane-1,2-diyl)bis(N-(3,4-dimethoxybenzylidene)aniline) ID: ALA2268784
PubChem CID: 11272155
Max Phase: Preclinical
Molecular Formula: C32H32N2O4
Molecular Weight: 508.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=N/c2ccc(CCc3ccc(/N=C/c4ccc(OC)c(OC)c4)cc3)cc2)cc1OC
Standard InChI: InChI=1S/C32H32N2O4/c1-35-29-17-11-25(19-31(29)37-3)21-33-27-13-7-23(8-14-27)5-6-24-9-15-28(16-10-24)34-22-26-12-18-30(36-2)32(20-26)38-4/h7-22H,5-6H2,1-4H3/b33-21+,34-22+
Standard InChI Key: QGRZHFUUWDDJOH-WXGDAXOSSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
23.8961 -9.1837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3120 -9.8857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1283 -9.8719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5254 -9.1567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1001 -8.4539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2852 -8.4712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3424 -9.1414 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.7377 -8.4262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5548 -8.4110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9747 -9.1127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7910 -9.0978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1872 -8.3821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7610 -7.6798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9461 -7.6982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6364 -7.7682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2236 -8.4718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6265 -9.1791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4421 -9.1839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8530 -8.4755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4478 -7.7712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6702 -8.4770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4064 -8.4666 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0023 -7.7564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1852 -7.7512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7800 -7.0405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9636 -7.0350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5507 -7.7406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9581 -8.4533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7732 -8.4553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0776 -9.1854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1538 -6.9632 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.9708 -6.9451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0042 -8.3657 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.4269 -9.0651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5595 -6.3247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9725 -5.6196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7335 -7.7365 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3285 -7.0267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
19 21 1 0
16 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
21 30 1 0
30 1 1 0
13 31 1 0
31 32 1 0
12 33 1 0
33 34 1 0
26 35 1 0
35 36 1 0
27 37 1 0
37 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.62Molecular Weight (Monoisotopic): 508.2362AlogP: 7.01#Rotatable Bonds: 11Polar Surface Area: 61.64Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 3.00CX LogP: 7.63CX LogD: 7.63Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.20Np Likeness Score: -0.34
References 1. Siddiqui IR, Singh PK, Singh J, Singh J.. (2003) Synthesis and fungicidal activity of novel 4,4'-bis(2' '-aryl-5' '-methyl/unsubstituted-4' '-oxo-thiazolidin-3' '-yl) bibenzyl., 51 (24): [PMID:14611172 ] [10.1021/jf0342324 ]