The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4,4'-(4,4'-(ethane-1,2-diyl)bis(4,1-phenylene))bis(azan-1-yl-1-ylidene)bis(methan-1-yl-1-ylidene)bis(2-methoxyphenol) ID: ALA2268786
PubChem CID: 135440173
Max Phase: Preclinical
Molecular Formula: C30H28N2O4
Molecular Weight: 480.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=N/c2ccc(CCc3ccc(/N=C/c4ccc(O)c(OC)c4)cc3)cc2)ccc1O
Standard InChI: InChI=1S/C30H28N2O4/c1-35-29-17-23(9-15-27(29)33)19-31-25-11-5-21(6-12-25)3-4-22-7-13-26(14-8-22)32-20-24-10-16-28(34)30(18-24)36-2/h5-20,33-34H,3-4H2,1-2H3/b31-19+,32-20+
Standard InChI Key: GAZNSLYPSMMSST-GKTLAHRSSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
23.9621 -14.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3780 -15.6969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1943 -15.6831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5914 -14.9678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1662 -14.2650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3513 -14.2823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4085 -14.9526 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.8038 -14.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6208 -14.2221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0408 -14.9238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8571 -14.9090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2532 -14.1932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8270 -13.4910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0122 -13.5093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7025 -13.5793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2896 -14.2830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6926 -14.9902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5081 -14.9950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9191 -14.2867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5138 -13.5823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7363 -14.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4725 -14.2778 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0684 -13.5675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2512 -13.5623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8460 -12.8517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0296 -12.8461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6167 -13.5517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0242 -14.2644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8393 -14.2664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1436 -14.9966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2198 -12.7744 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.0368 -12.7563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0702 -14.1769 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6255 -12.1359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0385 -11.4307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7996 -13.5476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
19 21 1 0
16 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
21 30 1 0
30 1 1 0
13 31 1 0
31 32 1 0
12 33 1 0
26 34 1 0
34 35 1 0
27 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 480.56Molecular Weight (Monoisotopic): 480.2049AlogP: 6.40#Rotatable Bonds: 9Polar Surface Area: 83.64Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.85CX Basic pKa: 3.01CX LogP: 7.34CX LogD: 7.32Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.27Np Likeness Score: -0.15
References 1. Siddiqui IR, Singh PK, Singh J, Singh J.. (2003) Synthesis and fungicidal activity of novel 4,4'-bis(2' '-aryl-5' '-methyl/unsubstituted-4' '-oxo-thiazolidin-3' '-yl) bibenzyl., 51 (24): [PMID:14611172 ] [10.1021/jf0342324 ]