(2S,2'S)-3,3'-(4,4'-(ethane-1,2-diyl)bis(4,1-phenylene))bis(2-phenylthiazolidin-4-one)

ID: ALA2268787

PubChem CID: 11341645

Max Phase: Preclinical

Molecular Formula: C32H28N2O2S2

Molecular Weight: 536.72

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1CS[C@@H](c2ccccc2)N1c1ccc(CCc2ccc(N3C(=O)CS[C@H]3c3ccccc3)cc2)cc1

Standard InChI:  InChI=1S/C32H28N2O2S2/c35-29-21-37-31(25-7-3-1-4-8-25)33(29)27-17-13-23(14-18-27)11-12-24-15-19-28(20-16-24)34-30(36)22-38-32(34)26-9-5-2-6-10-26/h1-10,13-20,31-32H,11-12,21-22H2/t31-,32-/m0/s1

Standard InChI Key:  WEKDIRZCKHRWCE-ACHIHNKUSA-N

Molfile:  

     RDKit          2D

 38 43  0  0  0  0  0  0  0  0999 V2000
    8.8524  -19.6494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4393  -20.3522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8413  -21.0593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6563  -21.0648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0676  -20.3572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6632  -19.6531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6221  -20.3464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8848  -20.3594    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3677  -21.0218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1455  -20.7713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1477  -19.9540    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.3711  -19.6996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1147  -21.7988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1222  -18.9212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6725  -18.3206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4242  -17.5429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6249  -17.3686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0744  -17.9783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3256  -18.7536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9842  -20.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3887  -19.6470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9782  -18.9448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1631  -18.9492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7605  -19.6617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1734  -20.3609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2059  -19.6430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9433  -19.6694    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4525  -19.0129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6777  -19.2728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6854  -20.0900    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.4650  -20.3350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6960  -18.2328    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7233  -21.1103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1803  -21.7175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4380  -22.4922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2393  -22.6568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7824  -22.0406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5218  -21.2682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  5  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12  8  1  0
  9 13  2  0
 12 14  1  6
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 21 26  1  0
 24 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 27  1  0
 28 32  2  0
 31 33  1  6
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 33  1  0
 26  7  1  0
M  END

Associated Targets(non-human)

Penicillium citrinum (522 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Fusarium oxysporum (3998 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 536.72Molecular Weight (Monoisotopic): 536.1592AlogP: 7.03#Rotatable Bonds: 7
Polar Surface Area: 40.62Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 6.92CX LogD: 6.92
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.25Np Likeness Score: -0.44

References

1. Siddiqui IR, Singh PK, Singh J, Singh J..  (2003)  Synthesis and fungicidal activity of novel 4,4'-bis(2' '-aryl-5' '-methyl/unsubstituted-4' '-oxo-thiazolidin-3' '-yl) bibenzyl.,  51  (24): [PMID:14611172] [10.1021/jf0342324]

Source