(2S,2'S)-3,3'-(4,4'-(ethane-1,2-diyl)bis(4,1-phenylene))bis(2-(3,4-dimethoxyphenyl)thiazolidin-4-one)

ID: ALA2268790

PubChem CID: 11250847

Max Phase: Preclinical

Molecular Formula: C36H36N2O6S2

Molecular Weight: 656.83

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc([C@@H]2SCC(=O)N2c2ccc(CCc3ccc(N4C(=O)CS[C@H]4c4ccc(OC)c(OC)c4)cc3)cc2)cc1OC

Standard InChI:  InChI=1S/C36H36N2O6S2/c1-41-29-17-11-25(19-31(29)43-3)35-37(33(39)21-45-35)27-13-7-23(8-14-27)5-6-24-9-15-28(16-10-24)38-34(40)22-46-36(38)26-12-18-30(42-2)32(20-26)44-4/h7-20,35-36H,5-6,21-22H2,1-4H3/t35-,36-/m0/s1

Standard InChI Key:  IECUCFUJAQYJLP-ZPGRZCPFSA-N

Molfile:  

     RDKit          2D

 46 51  0  0  0  0  0  0  0  0999 V2000
    8.2333  -25.8361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8202  -26.5389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2222  -27.2460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0372  -27.2515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4485  -26.5440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0441  -25.8398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0030  -26.5331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2657  -26.5461    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7486  -27.2085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5264  -26.9580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5286  -26.1407    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.7520  -25.8863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4957  -27.9856    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5031  -25.1080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0535  -24.5073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8051  -23.7296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0058  -23.5553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4553  -24.1650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7065  -24.9404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3651  -26.5415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7696  -25.8337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3591  -25.1315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5441  -25.1359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1414  -25.8484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5543  -26.5476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5868  -25.8297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3242  -25.8561    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8334  -25.1996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0586  -25.4595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0663  -26.2767    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.8459  -26.5217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0769  -24.4195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1042  -27.2970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5612  -27.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8189  -28.6789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6202  -28.8435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1634  -28.2273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9028  -27.4550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9645  -28.3884    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2255  -29.1628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8796  -29.6185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3381  -30.2305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3551  -23.1251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1535  -23.2991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7559  -22.7773    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3047  -22.1718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  5  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12  8  1  0
  9 13  2  0
 12 14  1  6
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 21 26  1  0
 24 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 27  1  0
 28 32  2  0
 31 33  1  6
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 33  1  0
 26  7  1  0
 37 39  1  0
 39 40  1  0
 36 41  1  0
 41 42  1  0
 16 43  1  0
 43 44  1  0
 17 45  1  0
 45 46  1  0
M  END

Associated Targets(non-human)

Penicillium citrinum (522 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Fusarium oxysporum (3998 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 656.83Molecular Weight (Monoisotopic): 656.2015AlogP: 7.06#Rotatable Bonds: 11
Polar Surface Area: 77.54Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 6.29CX LogD: 6.29
Aromatic Rings: 4Heavy Atoms: 46QED Weighted: 0.17Np Likeness Score: -0.30

References

1. Siddiqui IR, Singh PK, Singh J, Singh J..  (2003)  Synthesis and fungicidal activity of novel 4,4'-bis(2' '-aryl-5' '-methyl/unsubstituted-4' '-oxo-thiazolidin-3' '-yl) bibenzyl.,  51  (24): [PMID:14611172] [10.1021/jf0342324]

Source