The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,2'S)-3,3'-(4,4'-(ethane-1,2-diyl)bis(4,1-phenylene))bis(2-(3,4-dimethoxyphenyl)thiazolidin-4-one) ID: ALA2268790
PubChem CID: 11250847
Max Phase: Preclinical
Molecular Formula: C36H36N2O6S2
Molecular Weight: 656.83
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc([C@@H]2SCC(=O)N2c2ccc(CCc3ccc(N4C(=O)CS[C@H]4c4ccc(OC)c(OC)c4)cc3)cc2)cc1OC
Standard InChI: InChI=1S/C36H36N2O6S2/c1-41-29-17-11-25(19-31(29)43-3)35-37(33(39)21-45-35)27-13-7-23(8-14-27)5-6-24-9-15-28(16-10-24)38-34(40)22-46-36(38)26-12-18-30(42-2)32(20-26)44-4/h7-20,35-36H,5-6,21-22H2,1-4H3/t35-,36-/m0/s1
Standard InChI Key: IECUCFUJAQYJLP-ZPGRZCPFSA-N
Molfile:
RDKit 2D
46 51 0 0 0 0 0 0 0 0999 V2000
8.2333 -25.8361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8202 -26.5389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2222 -27.2460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0372 -27.2515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4485 -26.5440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0441 -25.8398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0030 -26.5331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2657 -26.5461 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7486 -27.2085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5264 -26.9580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5286 -26.1407 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.7520 -25.8863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4957 -27.9856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5031 -25.1080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0535 -24.5073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8051 -23.7296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0058 -23.5553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4553 -24.1650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7065 -24.9404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3651 -26.5415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7696 -25.8337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3591 -25.1315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5441 -25.1359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1414 -25.8484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5543 -26.5476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5868 -25.8297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3242 -25.8561 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8334 -25.1996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0586 -25.4595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0663 -26.2767 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.8459 -26.5217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0769 -24.4195 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1042 -27.2970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5612 -27.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8189 -28.6789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6202 -28.8435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1634 -28.2273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9028 -27.4550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9645 -28.3884 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2255 -29.1628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8796 -29.6185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3381 -30.2305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3551 -23.1251 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1535 -23.2991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7559 -22.7773 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3047 -22.1718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
5 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 8 1 0
9 13 2 0
12 14 1 6
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
21 26 1 0
24 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 27 1 0
28 32 2 0
31 33 1 6
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
26 7 1 0
37 39 1 0
39 40 1 0
36 41 1 0
41 42 1 0
16 43 1 0
43 44 1 0
17 45 1 0
45 46 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 656.83Molecular Weight (Monoisotopic): 656.2015AlogP: 7.06#Rotatable Bonds: 11Polar Surface Area: 77.54Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.29CX LogD: 6.29Aromatic Rings: 4Heavy Atoms: 46QED Weighted: 0.17Np Likeness Score: -0.30
References 1. Siddiqui IR, Singh PK, Singh J, Singh J.. (2003) Synthesis and fungicidal activity of novel 4,4'-bis(2' '-aryl-5' '-methyl/unsubstituted-4' '-oxo-thiazolidin-3' '-yl) bibenzyl., 51 (24): [PMID:14611172 ] [10.1021/jf0342324 ]