The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,2'S)-3,3'-(4,4'-(ethane-1,2-diyl)bis(4,1-phenylene))bis(2-(2-hydroxyphenyl)thiazolidin-4-one) ID: ALA2268791
PubChem CID: 11250020
Max Phase: Preclinical
Molecular Formula: C32H28N2O4S2
Molecular Weight: 568.72
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1CS[C@@H](c2ccccc2O)N1c1ccc(CCc2ccc(N3C(=O)CS[C@H]3c3ccccc3O)cc2)cc1
Standard InChI: InChI=1S/C32H28N2O4S2/c35-27-7-3-1-5-25(27)31-33(29(37)19-39-31)23-15-11-21(12-16-23)9-10-22-13-17-24(18-14-22)34-30(38)20-40-32(34)26-6-2-4-8-28(26)36/h1-8,11-18,31-32,35-36H,9-10,19-20H2/t31-,32-/m0/s1
Standard InChI Key: VSEVEFPVCPLNEO-ACHIHNKUSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
19.1251 -26.6120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7119 -27.3149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1140 -28.0219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9290 -28.0274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3403 -27.3199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9359 -26.6157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8948 -27.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1575 -27.3220 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.6403 -27.9844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4182 -27.7339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4203 -26.9167 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.6438 -26.6622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3874 -28.7615 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.3949 -25.8839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9452 -25.2833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6969 -24.5055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8976 -24.3313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3471 -24.9409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5983 -25.7163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2568 -27.3174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6614 -26.6096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2508 -25.9074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4358 -25.9118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0331 -26.6243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4460 -27.3235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4786 -26.6056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2160 -26.6320 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7251 -25.9755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9504 -26.2354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9581 -27.0526 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.7377 -27.2976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9686 -25.1955 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9960 -28.0729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4529 -28.6802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7107 -29.4549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5120 -29.6194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0551 -29.0032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7945 -28.2309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6527 -28.5144 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7434 -25.4587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
5 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 8 1 0
9 13 2 0
12 14 1 6
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
21 26 1 0
24 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 27 1 0
28 32 2 0
31 33 1 6
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
26 7 1 0
34 39 1 0
15 40 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 568.72Molecular Weight (Monoisotopic): 568.1490AlogP: 6.44#Rotatable Bonds: 7Polar Surface Area: 81.08Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.79CX Basic pKa: ┄CX LogP: 6.31CX LogD: 6.30Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.27Np Likeness Score: -0.24
References 1. Siddiqui IR, Singh PK, Singh J, Singh J.. (2003) Synthesis and fungicidal activity of novel 4,4'-bis(2' '-aryl-5' '-methyl/unsubstituted-4' '-oxo-thiazolidin-3' '-yl) bibenzyl., 51 (24): [PMID:14611172 ] [10.1021/jf0342324 ]