The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,2'S)-3,3'-(4,4'-(ethane-1,2-diyl)bis(4,1-phenylene))bis(2-(4-hydroxy-3-methoxyphenyl)thiazolidin-4-one) ID: ALA2268792
PubChem CID: 11331087
Max Phase: Preclinical
Molecular Formula: C34H32N2O6S2
Molecular Weight: 628.77
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc([C@@H]2SCC(=O)N2c2ccc(CCc3ccc(N4C(=O)CS[C@H]4c4ccc(O)c(OC)c4)cc3)cc2)ccc1O
Standard InChI: InChI=1S/C34H32N2O6S2/c1-41-29-17-23(9-15-27(29)37)33-35(31(39)19-43-33)25-11-5-21(6-12-25)3-4-22-7-13-26(14-8-22)36-32(40)20-44-34(36)24-10-16-28(38)30(18-24)42-2/h5-18,33-34,37-38H,3-4,19-20H2,1-2H3/t33-,34-/m0/s1
Standard InChI Key: FCYLNVMVCQMYKW-HEVIKAOCSA-N
Molfile:
RDKit 2D
44 49 0 0 0 0 0 0 0 0999 V2000
30.7473 -26.1374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3342 -26.8402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7363 -27.5473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5513 -27.5528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9626 -26.8452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5581 -26.1411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5171 -26.8344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7797 -26.8474 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.2626 -27.5098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0405 -27.2593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0426 -26.4420 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
33.2661 -26.1876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0097 -28.2868 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.0172 -25.4092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5675 -24.8086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3192 -24.0309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5199 -23.8566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9693 -24.4663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2206 -25.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8791 -26.8428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2837 -26.1350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8731 -25.4328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0581 -25.4372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6554 -26.1497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0683 -26.8489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1009 -26.1310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8383 -26.1574 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3474 -25.5009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5726 -25.7608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5804 -26.5780 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
25.3599 -26.8230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5909 -24.7208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.6182 -27.5983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0752 -28.2055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3329 -28.9802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1343 -29.1448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6774 -28.5286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4168 -27.7563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4785 -28.6897 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.7396 -29.4641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3936 -29.9198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.8691 -23.4264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.6675 -23.6004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2699 -23.0786 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
5 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 8 1 0
9 13 2 0
12 14 1 6
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
21 26 1 0
24 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 27 1 0
28 32 2 0
31 33 1 6
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
26 7 1 0
37 39 1 0
39 40 1 0
36 41 1 0
16 42 1 0
42 43 1 0
17 44 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 628.77Molecular Weight (Monoisotopic): 628.1702AlogP: 6.46#Rotatable Bonds: 9Polar Surface Area: 99.54Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.61CX Basic pKa: ┄CX LogP: 6.00CX LogD: 6.00Aromatic Rings: 4Heavy Atoms: 44QED Weighted: 0.22Np Likeness Score: -0.14
References 1. Siddiqui IR, Singh PK, Singh J, Singh J.. (2003) Synthesis and fungicidal activity of novel 4,4'-bis(2' '-aryl-5' '-methyl/unsubstituted-4' '-oxo-thiazolidin-3' '-yl) bibenzyl., 51 (24): [PMID:14611172 ] [10.1021/jf0342324 ]