(2S,2'S,5S,5'S)-3,3'-(4,4'-(ethane-1,2-diyl)bis(4,1-phenylene))bis(5-methyl-2-phenylthiazolidin-4-one)

ID: ALA2268793

PubChem CID: 11180551

Max Phase: Preclinical

Molecular Formula: C34H32N2O2S2

Molecular Weight: 564.78

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@H]1S[C@@H](c2ccccc2)N(c2ccc(CCc3ccc(N4C(=O)[C@H](C)S[C@H]4c4ccccc4)cc3)cc2)C1=O

Standard InChI:  InChI=1S/C34H32N2O2S2/c1-23-31(37)35(33(39-23)27-9-5-3-6-10-27)29-19-15-25(16-20-29)13-14-26-17-21-30(22-18-26)36-32(38)24(2)40-34(36)28-11-7-4-8-12-28/h3-12,15-24,33-34H,13-14H2,1-2H3/t23-,24-,33-,34-/m0/s1

Standard InChI Key:  SFUNWVDIBHRLDC-OXFWVDDSSA-N

Molfile:  

     RDKit          2D

 40 45  0  0  0  0  0  0  0  0999 V2000
    7.2758   -3.1694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8627   -3.8722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2647   -4.5793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0797   -4.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4910   -3.8772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0866   -3.1730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0455   -3.8663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3082   -3.8794    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7911   -4.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5689   -4.2913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5711   -3.4740    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.7945   -3.2196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5381   -5.3188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5456   -2.4412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0959   -1.8406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8476   -1.0629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0483   -0.8886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4978   -1.4982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7490   -2.2736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4076   -3.8747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8121   -3.1669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4016   -2.4648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5865   -2.4692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1839   -3.1816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5968   -3.8809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6293   -3.1629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3667   -3.1894    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8759   -2.5329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1011   -2.7928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1088   -3.6100    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.8884   -3.8550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1194   -1.7528    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1467   -4.6303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6037   -5.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8614   -6.0122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6627   -6.1768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2058   -5.5605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9452   -4.7882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4354   -2.3187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2288   -4.7733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  5  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12  8  1  0
  9 13  2  0
 12 14  1  6
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 21 26  1  0
 24 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 27  1  0
 28 32  2  0
 31 33  1  6
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 33  1  0
 26  7  1  0
 29 39  1  1
 10 40  1  1
M  END

Associated Targets(non-human)

Penicillium citrinum (522 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Fusarium oxysporum (3998 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 564.78Molecular Weight (Monoisotopic): 564.1905AlogP: 7.81#Rotatable Bonds: 7
Polar Surface Area: 40.62Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 8.06CX LogD: 8.06
Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.23Np Likeness Score: -0.26

References

1. Siddiqui IR, Singh PK, Singh J, Singh J..  (2003)  Synthesis and fungicidal activity of novel 4,4'-bis(2' '-aryl-5' '-methyl/unsubstituted-4' '-oxo-thiazolidin-3' '-yl) bibenzyl.,  51  (24): [PMID:14611172] [10.1021/jf0342324]

Source