The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Methoxy-4,4'-oxyneolign-9,9'-dioic acid ID: ALA2269136
PubChem CID: 11617133
Max Phase: Preclinical
Molecular Formula: C19H20O6
Molecular Weight: 344.36
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(CCC(=O)O)ccc1Oc1ccc(CCC(=O)O)cc1
Standard InChI: InChI=1S/C19H20O6/c1-24-17-12-14(6-11-19(22)23)4-9-16(17)25-15-7-2-13(3-8-15)5-10-18(20)21/h2-4,7-9,12H,5-6,10-11H2,1H3,(H,20,21)(H,22,23)
Standard InChI Key: SLWZVKXLJQIUKB-UHFFFAOYSA-N
Molfile:
RDKit 2D
25 26 0 0 0 0 0 0 0 0999 V2000
16.5606 -1.9749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5594 -2.8022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2742 -3.2151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9907 -2.8017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9877 -1.9713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2724 -1.5621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7007 -1.5561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4167 -1.9658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4164 -2.7885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1316 -3.1982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8455 -2.7830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8396 -1.9537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1240 -1.5478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8446 -3.2141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1306 -2.8011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4157 -3.2130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7011 -2.8021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4146 -4.0402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.5619 -3.1918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2744 -2.7757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9908 -3.1845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9977 -4.0091 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7059 -2.7680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2700 -0.7372 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9832 -0.3225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
2 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
11 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
6 24 1 0
24 25 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 344.36Molecular Weight (Monoisotopic): 344.1260AlogP: 3.52#Rotatable Bonds: 9Polar Surface Area: 93.06Molecular Species: ACIDHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.35CX Basic pKa: ┄CX LogP: 3.48CX LogD: -3.17Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.72Np Likeness Score: 0.07
References 1. DellaGreca M, Di Marino C, Previtera L, Purcaro R, Zarrelli A. (2005) Apteniols AF, oxyneolignans from the leaves of Aptenia cordifolia, 61 (50): [10.1016/j.tet.2005.09.054 ]