The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
acetylusaramine ID: ALA2269159
PubChem CID: 76330453
Max Phase: Preclinical
Molecular Formula: C20H27NO7
Molecular Weight: 393.44
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C/C=C1\C[C@@H](C)[C@](O)(COC(C)=O)C(=O)OCC2=CCN3CC[C@@H](OC1=O)[C@@H]23
Standard InChI: InChI=1S/C20H27NO7/c1-4-14-9-12(2)20(25,11-27-13(3)22)19(24)26-10-15-5-7-21-8-6-16(17(15)21)28-18(14)23/h4-5,12,16-17,25H,6-11H2,1-3H3/b14-4+/t12-,16-,17-,20-/m1/s1
Standard InChI Key: KLRFTGKPNAYUMI-QTMWKHJZSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
18.3481 -13.7503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3431 -12.4649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8810 -13.1066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1041 -12.7076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1041 -13.5001 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.8566 -13.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3247 -13.1038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8576 -12.4630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8644 -11.6706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3670 -11.6728 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5548 -11.2803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5616 -10.4879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2521 -10.0935 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6922 -11.2560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7162 -10.4639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9935 -11.6313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4149 -10.0845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0414 -10.0472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1117 -10.5114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8299 -10.1215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0904 -11.3284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2317 -9.4101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4145 -9.4101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8164 -8.7063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0656 -9.2303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2183 -7.9947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8031 -7.2909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0355 -7.9870 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 5 1 0
4 2 1 0
2 3 1 0
3 1 1 0
4 5 1 1
5 6 1 0
6 7 1 0
7 8 2 0
8 4 1 0
8 9 1 0
2 10 1 1
9 11 1 0
11 12 1 0
12 13 2 0
12 20 1 0
10 14 1 0
14 15 1 0
14 16 2 0
15 17 1 0
15 18 2 0
17 19 1 0
19 20 1 0
19 21 1 6
20 22 1 6
20 23 1 0
22 24 1 0
18 25 1 0
24 26 1 0
26 27 1 0
26 28 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 393.44Molecular Weight (Monoisotopic): 393.1788AlogP: 0.74#Rotatable Bonds: 2Polar Surface Area: 102.37Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.41CX Basic pKa: 8.14CX LogP: 1.04CX LogD: 0.23Aromatic Rings: ┄Heavy Atoms: 28QED Weighted: 0.32Np Likeness Score: 2.75