The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Acetylsenkirkine ID: ALA2269161
PubChem CID: 76323199
Max Phase: Preclinical
Molecular Formula: C21H29NO7
Molecular Weight: 407.46
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C/C=C1/C[C@@H](C)[C@@](C)(OC(C)=O)C(=O)OC/C2=C/CN(C)CC[C@@H](OC1=O)C2=O
Standard InChI: InChI=1S/C21H29NO7/c1-6-15-11-13(2)21(4,29-14(3)23)20(26)27-12-16-7-9-22(5)10-8-17(18(16)24)28-19(15)25/h6-7,13,17H,8-12H2,1-5H3/b15-6-,16-7-/t13-,17-,21-/m1/s1
Standard InChI Key: ZOIAVVNLMDKOIV-CJRSJGLVSA-N
Molfile:
RDKit 2D
29 30 0 0 0 0 0 0 0 0999 V2000
38.2331 -13.2262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2281 -11.9407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7660 -12.5824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9891 -12.1834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9891 -12.9760 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.7416 -13.2244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2097 -12.5797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7426 -11.9389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7494 -11.1465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2520 -11.1486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.4398 -10.7562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.4466 -9.9638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1371 -9.5693 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.5772 -10.7319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6012 -9.9398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8785 -11.1072 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.2999 -9.5603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9264 -9.5230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2068 -9.9104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9967 -9.9873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7148 -9.5973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9754 -10.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1167 -8.8859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2995 -8.8859 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.9817 -13.7891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4039 -12.7573 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.7046 -8.1762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2926 -7.4705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.5218 -8.1722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 5 1 0
4 2 1 0
2 3 1 0
3 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 4 1 0
8 9 1 0
2 10 1 1
9 11 1 0
11 12 1 0
12 13 2 0
12 21 1 0
10 14 1 0
14 15 1 0
14 16 2 0
15 17 1 0
15 18 2 0
18 19 1 0
17 20 1 0
20 21 1 0
20 22 1 6
21 23 1 6
21 24 1 0
5 25 1 0
4 26 2 0
24 27 1 0
27 28 2 0
27 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 407.46Molecular Weight (Monoisotopic): 407.1944AlogP: 1.58#Rotatable Bonds: 1Polar Surface Area: 99.21Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.96CX LogP: 2.33CX LogD: 2.20Aromatic Rings: ┄Heavy Atoms: 29QED Weighted: 0.37Np Likeness Score: 2.29