The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-hydroxy-6-(3-hydroxy-8-(hydroxymethyl)-2,6,10,12-tetramethyloctadeca-4,6,9-trien-2-yl)-3-(2-hydroxyethyl)-2H-pyran-2-one ID: ALA2269329
PubChem CID: 54676271
Max Phase: Preclinical
Molecular Formula: C30H48O6
Molecular Weight: 504.71
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCC(C)C/C(C)=C\C(/C=C(C)/C=C/C(O)C(C)(C)c1cc(O)c(CCO)c(=O)o1)CO
Standard InChI: InChI=1S/C30H48O6/c1-7-8-9-10-11-21(2)16-23(4)18-24(20-32)17-22(3)12-13-27(34)30(5,6)28-19-26(33)25(14-15-31)29(35)36-28/h12-13,17-19,21,24,27,31-34H,7-11,14-16,20H2,1-6H3/b13-12+,22-17+,23-18-
Standard InChI Key: FFTOWXZOJFEINY-YJBWKGOYSA-N
Molfile:
RDKit 2D
36 36 0 0 0 0 0 0 0 0999 V2000
14.6645 -11.3624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5565 -11.2454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0873 -11.3643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8151 -11.3585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9724 -10.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8422 -9.3001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5512 -8.0637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9550 -10.1293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6435 -11.7799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3777 -10.1312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1095 -10.1254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2166 -11.7779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3977 -10.5351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3753 -11.7741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5512 -10.5278 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7940 -11.7760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1315 -10.5331 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6657 -10.5409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8422 -10.1214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1568 -8.8594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9285 -11.3682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2389 -10.5390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3780 -11.2465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5281 -10.1273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6869 -10.1234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5512 -8.8851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6880 -9.3021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3742 -12.5955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2378 -11.3604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8162 -10.5370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9528 -11.7721 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2642 -9.3001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5058 -11.3662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2642 -10.1214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1959 -8.0431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5085 -7.6012 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24 22 1 0
25 27 1 0
18 1 1 0
30 4 1 0
8 18 2 0
1 14 1 0
29 31 1 0
33 12 1 0
2 5 1 0
34 5 1 0
14 28 1 0
22 29 1 0
16 33 1 0
26 7 1 0
12 21 1 0
19 17 2 0
6 26 2 0
32 26 1 0
11 30 1 0
25 13 1 0
6 19 1 0
13 11 2 0
34 32 2 0
14 3 1 0
30 24 2 0
19 15 1 0
21 9 1 0
3 16 1 0
15 34 1 0
22 8 1 0
5 25 1 0
20 6 1 0
18 10 1 0
5 23 1 0
20 35 1 0
35 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 504.71Molecular Weight (Monoisotopic): 504.3451AlogP: 5.57#Rotatable Bonds: 16Polar Surface Area: 111.13Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.58CX Basic pKa: ┄CX LogP: 5.43CX LogD: 5.21Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.13Np Likeness Score: 1.97
References 1. Altomare C, Pengue R, Favilla M, Evidente A, Visconti A.. (2004) Structure-activity relationships of derivatives of fusapyrone, an antifungal metabolite of Fusarium semitectum., 52 (10): [PMID:15137845 ] [10.1021/jf035233z ]