The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-deoxy-beta-xylo-hexopyranosyl)-4-hydroxy-6-(2-hydroxy-7-hydroxymethyl-1,1,5,9,11-pentamethyl-3,5,8-heptadecatrienyl)-2H-pyran-2-one ID: ALA2269337
Cas Number: 927209-87-8
PubChem CID: 54684865
Product Number: N463107, Order Now?
Max Phase: Preclinical
Molecular Formula: C34H54O9
Molecular Weight: 606.80
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCC(C)C/C(C)=C\C(/C=C(C)/C=C/C(O)C(C)(C)c1cc(O)c([C@@H]2O[C@H](CO)C[C@H](O)[C@H]2O)c(=O)o1)CO
Standard InChI: InChI=1S/C34H54O9/c1-7-8-9-10-11-21(2)14-23(4)16-24(19-35)15-22(3)12-13-28(39)34(5,6)29-18-26(37)30(33(41)43-29)32-31(40)27(38)17-25(20-36)42-32/h12-13,15-16,18,21,24-25,27-28,31-32,35-40H,7-11,14,17,19-20H2,1-6H3/b13-12+,22-15+,23-16-/t21?,24?,25-,27-,28?,31+,32-/m0/s1
Standard InChI Key: HEECQDWUNPZALD-ZBNIOBMFSA-N
Molfile:
RDKit 2D
43 44 0 0 0 0 0 0 0 0999 V2000
3.9201 -3.5137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2306 -3.0689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5019 -3.4480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4664 -4.2698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8106 -3.0089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0819 -3.3879 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5711 -1.8100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2643 -2.2528 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6065 -0.9881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3352 -0.6091 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8460 -2.1871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0586 -4.7524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6427 -5.4673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4683 -5.4684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9201 -4.3392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6332 -4.7456 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3462 -4.3392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3462 -3.5137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6332 -3.0946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2053 -4.7509 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6332 -2.2691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7772 -4.3412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4921 -4.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7783 -3.5157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2081 -4.3432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9189 -4.7548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6349 -4.3451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9178 -5.5804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3498 -4.7568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0659 -4.3471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3487 -5.5823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0637 -5.9981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7808 -4.7587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4969 -4.3490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7796 -5.5843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4945 -6.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4934 -6.8256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2106 -5.5862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9214 -6.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6374 -5.5881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3523 -6.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0683 -5.5901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7833 -6.0059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
2 3 1 0
3 4 1 6
3 5 1 0
5 6 1 1
7 8 1 0
7 9 1 1
9 10 1 0
7 11 1 0
5 11 1 0
2 8 1 0
13 12 1 0
12 14 1 0
1 15 1 0
1 19 2 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
15 20 2 0
19 21 1 0
17 12 1 0
12 22 1 0
22 23 1 0
22 24 1 0
23 25 2 0
25 26 1 0
26 27 2 0
26 28 1 0
27 29 1 0
29 30 1 0
29 31 1 0
31 32 1 0
30 33 2 0
33 34 1 0
33 35 1 0
35 36 1 0
36 37 1 0
36 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 42 1 0
42 43 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 606.80Molecular Weight (Monoisotopic): 606.3768AlogP: 4.58#Rotatable Bonds: 16Polar Surface Area: 160.82Molecular Species: NEUTRALHBA: 9HBD: 6#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.10CX Basic pKa: ┄CX LogP: 3.84CX LogD: 3.36Aromatic Rings: 1Heavy Atoms: 43QED Weighted: 0.09Np Likeness Score: 2.32
References 1. Altomare C, Pengue R, Favilla M, Evidente A, Visconti A.. (2004) Structure-activity relationships of derivatives of fusapyrone, an antifungal metabolite of Fusarium semitectum., 52 (10): [PMID:15137845 ] [10.1021/jf035233z ]