Dumsenin

ID: ALA2269340

PubChem CID: 76334053

Max Phase: Preclinical

Molecular Formula: C30H36O9

Molecular Weight: 540.61

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)O[C@H]1[C@H](OC(C)=O)[C@@]2(C)C(=CC[C@@H]2c2ccoc2)[C@@]2(C)C(=O)C[C@H]3C(C)(C)O[C@]4(O)C(=O)CC[C@]34[C@@H]12

Standard InChI:  InChI=1S/C30H36O9/c1-15(31)37-23-24-28(6,22(34)13-20-26(3,4)39-30(35)21(33)9-11-29(20,24)30)19-8-7-18(17-10-12-36-14-17)27(19,5)25(23)38-16(2)32/h8,10,12,14,18,20,23-25,35H,7,9,11,13H2,1-6H3/t18-,20+,23-,24+,25+,27-,28+,29-,30-/m1/s1

Standard InChI Key:  SLDDPEDLCNASLZ-DELRWMBRSA-N

Molfile:  

     RDKit          2D

 39 44  0  0  0  0  0  0  0  0999 V2000
   14.3967   -9.8199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6636   -9.9740    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7720  -12.4082    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5171  -11.6544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7929  -12.8856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5741  -13.9689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0889  -13.2965    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2882  -11.0437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8544  -12.2202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1803   -9.0220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5088  -12.4818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8977  -10.4938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5698  -10.6314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5742  -12.6239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0785  -14.1177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0820  -11.6405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5051  -14.1257    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7758  -12.0829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3019  -11.4143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5660  -14.7922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7433   -9.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5610   -9.7384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2843  -12.7421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3625  -12.8879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3706  -11.2216    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8067  -11.2338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0948   -9.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1946  -10.0286    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8144  -10.4053    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8559  -14.3727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7919  -13.7089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0785  -12.4650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5109  -10.8288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7872  -12.0517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9148  -11.3079    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.3651  -13.7089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5784  -11.7998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3792  -10.3929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3715  -11.5513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5 11  1  0
 14  3  1  1
 31 17  2  0
 25 38  1  0
 24  9  1  6
  7  6  1  0
 23 18  1  0
 36 15  1  1
  6 36  1  0
 15 31  1  0
  4 11  1  0
  5 34  1  6
 38  2  2  0
 19 13  1  1
 39 37  1  0
 11 23  2  0
 32 16  1  1
 24 32  1  0
 21 13  1  0
 16 25  1  1
  6 30  1  0
  1 10  1  0
 18 19  1  0
 31  5  1  0
  4 26  1  0
 32  5  1  0
 36 24  1  0
 12 22  1  0
 22 21  2  0
 13  8  2  0
  9 39  1  0
 14  7  1  0
 14 24  1  0
 26 29  1  6
 29  1  1  0
  6 20  1  0
 26 16  1  0
 38 27  1  0
 37 14  1  0
 37 35  2  0
  4 33  1  1
  8 12  1  0
  1 28  2  0
 19  4  1  0
M  END

Alternative Forms

  1. Parent:

    ALA2269340

    DUMSENIN

Associated Targets(non-human)

Pectinophora gossypiella (16 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Spodoptera frugiperda (784 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 540.61Molecular Weight (Monoisotopic): 540.2359AlogP: 3.63#Rotatable Bonds: 3
Polar Surface Area: 129.34Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.97CX Basic pKa: CX LogP: 2.83CX LogD: 2.83
Aromatic Rings: 1Heavy Atoms: 39QED Weighted: 0.45Np Likeness Score: 3.10

References

1. Nihei K, Asaka Y, Mine Y, Ito C, Furukawa H, Ju-Ichi M, Kubo I..  (2004)  Insect antifeedants from tropical plants: structures of dumnin and dumsenin.,  52  (11): [PMID:15161191] [10.1021/jf049819c]

Source