The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Dumsenin ID: ALA2269340
PubChem CID: 76334053
Max Phase: Preclinical
Molecular Formula: C30H36O9
Molecular Weight: 540.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)O[C@H]1[C@H](OC(C)=O)[C@@]2(C)C(=CC[C@@H]2c2ccoc2)[C@@]2(C)C(=O)C[C@H]3C(C)(C)O[C@]4(O)C(=O)CC[C@]34[C@@H]12
Standard InChI: InChI=1S/C30H36O9/c1-15(31)37-23-24-28(6,22(34)13-20-26(3,4)39-30(35)21(33)9-11-29(20,24)30)19-8-7-18(17-10-12-36-14-17)27(19,5)25(23)38-16(2)32/h8,10,12,14,18,20,23-25,35H,7,9,11,13H2,1-6H3/t18-,20+,23-,24+,25+,27-,28+,29-,30-/m1/s1
Standard InChI Key: SLDDPEDLCNASLZ-DELRWMBRSA-N
Molfile:
RDKit 2D
39 44 0 0 0 0 0 0 0 0999 V2000
14.3967 -9.8199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6636 -9.9740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7720 -12.4082 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5171 -11.6544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7929 -12.8856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5741 -13.9689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0889 -13.2965 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2882 -11.0437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8544 -12.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1803 -9.0220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5088 -12.4818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8977 -10.4938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5698 -10.6314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5742 -12.6239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0785 -14.1177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0820 -11.6405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5051 -14.1257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7758 -12.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3019 -11.4143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5660 -14.7922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7433 -9.8253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5610 -9.7384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2843 -12.7421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3625 -12.8879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3706 -11.2216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8067 -11.2338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0948 -9.9876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1946 -10.0286 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8144 -10.4053 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8559 -14.3727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7919 -13.7089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0785 -12.4650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5109 -10.8288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7872 -12.0517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9148 -11.3079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3651 -13.7089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5784 -11.7998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3792 -10.3929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3715 -11.5513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 11 1 0
14 3 1 1
31 17 2 0
25 38 1 0
24 9 1 6
7 6 1 0
23 18 1 0
36 15 1 1
6 36 1 0
15 31 1 0
4 11 1 0
5 34 1 6
38 2 2 0
19 13 1 1
39 37 1 0
11 23 2 0
32 16 1 1
24 32 1 0
21 13 1 0
16 25 1 1
6 30 1 0
1 10 1 0
18 19 1 0
31 5 1 0
4 26 1 0
32 5 1 0
36 24 1 0
12 22 1 0
22 21 2 0
13 8 2 0
9 39 1 0
14 7 1 0
14 24 1 0
26 29 1 6
29 1 1 0
6 20 1 0
26 16 1 0
38 27 1 0
37 14 1 0
37 35 2 0
4 33 1 1
8 12 1 0
1 28 2 0
19 4 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 540.61Molecular Weight (Monoisotopic): 540.2359AlogP: 3.63#Rotatable Bonds: 3Polar Surface Area: 129.34Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.97CX Basic pKa: ┄CX LogP: 2.83CX LogD: 2.83Aromatic Rings: 1Heavy Atoms: 39QED Weighted: 0.45Np Likeness Score: 3.10
References 1. Nihei K, Asaka Y, Mine Y, Ito C, Furukawa H, Ju-Ichi M, Kubo I.. (2004) Insect antifeedants from tropical plants: structures of dumnin and dumsenin., 52 (11): [PMID:15161191 ] [10.1021/jf049819c ]