zumsin

ID: ALA2269343

PubChem CID: 76334054

Max Phase: Preclinical

Molecular Formula: C30H36O9

Molecular Weight: 540.61

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)O[C@@H]1[C@@H]2[C@@]34CC(=O)C[C@@H]3OC(C)(C)[C@@H]4CC(=O)[C@@]2(C)[C@@]23O[C@@H]2C[C@H](c2ccoc2)[C@]3(C)[C@H]1OC(C)=O

Standard InChI:  InChI=1S/C30H36O9/c1-14(31)36-23-24-28(6,20(34)11-19-26(3,4)38-21-9-17(33)12-29(19,21)24)30-22(39-30)10-18(16-7-8-35-13-16)27(30,5)25(23)37-15(2)32/h7-8,13,18-19,21-25H,9-12H2,1-6H3/t18-,19+,21+,22-,23-,24+,25+,27-,28-,29-,30-/m1/s1

Standard InChI Key:  PVWOAELREUNHIO-UGNJNTQISA-N

Molfile:  

     RDKit          2D

 39 45  0  0  0  0  0  0  0  0999 V2000
   22.8496  -12.4449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5611  -12.8578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1690  -12.3149    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.8311  -11.5645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0236  -11.6495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3834  -15.8981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0866  -15.4991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3834  -14.2652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0892  -14.6823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1023  -13.0479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3878  -13.4494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6740  -15.4991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4126  -15.0861    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8968  -15.7512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8970  -14.4206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6718  -14.6839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1597  -14.0204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6817  -13.3576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8989  -13.6058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1837  -16.1515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8890  -16.5680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1089  -12.2265    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.6915  -11.6399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4795  -11.8510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.4743  -10.8521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8082  -13.4629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0578  -13.8867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5848  -13.2210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5666  -14.5362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7964  -14.2817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9579  -15.0733    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.8017  -12.6444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0837  -13.8558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7956  -15.9090    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4641  -12.5617    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.9715  -12.7357    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.3778  -12.0253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9680  -11.3176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9532  -11.4413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  8 16  1  1
 12  6  1  1
  6  7  1  0
  7  9  1  0
  8  9  1  0
  8 11  1  0
  9 30  1  0
 26 10  1  0
 10 11  1  0
 12 16  1  0
 15 13  1  1
 13 14  1  0
 14 12  1  0
 15 16  1  0
 16 17  1  1
 17 18  1  0
 18 19  1  0
 19 15  1  0
 14 20  1  0
 14 21  1  0
 10 22  1  6
 22 23  1  0
 23 24  2  0
 23 25  1  0
 26 30  1  0
 29 27  1  0
 27 28  1  0
 28 26  1  0
 30 29  1  0
 30 31  1  1
 29 31  1  1
 26 32  1  6
  9 33  1  1
  7 34  2  0
 28  1  1  1
 18 35  2  0
 11 36  1  1
 36 37  1  0
 37 38  2  0
 37 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA2269343

    ZUMSIN

Associated Targets(non-human)

Spodoptera frugiperda (784 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Pectinophora gossypiella (16 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 540.61Molecular Weight (Monoisotopic): 540.2359AlogP: 3.53#Rotatable Bonds: 3
Polar Surface Area: 121.64Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 2.00CX LogD: 2.00
Aromatic Rings: 1Heavy Atoms: 39QED Weighted: 0.42Np Likeness Score: 3.37

References

1. Nihei K, Asaka Y, Mine Y, Ito C, Furukawa H, Ju-Ichi M, Kubo I..  (2004)  Insect antifeedants from tropical plants: structures of dumnin and dumsenin.,  52  (11): [PMID:15161191] [10.1021/jf049819c]
2. Nihei K, Hanke FJ, Asaka Y, Matsumoto T, Kubo I..  (2002)  Insect antifeedants from tropical plants II: structure of zumsin.,  50  (18): [PMID:12188606] [10.1021/jf020245q]

Source