The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
13-Butyl-2,3,9,10-tetramethoxy-5,6-dihydro-isoquino[3,2-a]isoquinoliny lium chloride ID: ALA2270081
PubChem CID: 76334096
Max Phase: Preclinical
Molecular Formula: C25H30ClNO4
Molecular Weight: 408.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCc1c2[n+](cc3c(OC)c(OC)ccc13)CCc1cc(OC)c(OC)cc1-2.[Cl-]
Standard InChI: InChI=1S/C25H30NO4.ClH/c1-6-7-8-18-17-9-10-21(27-2)25(30-5)20(17)15-26-12-11-16-13-22(28-3)23(29-4)14-19(16)24(18)26;/h9-10,13-15H,6-8,11-12H2,1-5H3;1H/q+1;/p-1
Standard InChI Key: SIMCDTUXLGJADR-UHFFFAOYSA-M
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
19.5116 -12.9386 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
16.6845 -13.5147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6827 -11.8693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3947 -12.2766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3981 -13.1058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8276 -12.2707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1072 -11.8568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8310 -13.0999 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1139 -13.5172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1168 -14.3423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5510 -13.5077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5521 -14.3390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8365 -14.7550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8399 -15.5807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5582 -15.9916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2745 -15.5706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2675 -14.7462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9729 -13.1037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9741 -12.2787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9757 -14.3305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.6898 -14.7358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9889 -15.9754 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.9956 -16.7966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2633 -11.8676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2615 -13.5137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5518 -12.2778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2608 -14.3349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4070 -14.7552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4096 -15.5764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6998 -15.9893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9873 -15.5810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18 2 1 0
2 5 2 0
4 3 2 0
3 19 1 0
4 5 1 0
4 7 1 0
5 9 1 0
8 6 1 0
6 7 1 0
8 9 1 0
8 11 2 0
9 10 2 0
10 13 1 0
12 11 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
18 19 2 0
17 20 1 0
20 21 1 0
16 22 1 0
22 23 1 0
19 24 1 0
18 25 1 0
24 26 1 0
25 27 1 0
10 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
M CHG 2 1 -1 8 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 408.52Molecular Weight (Monoisotopic): 408.2169AlogP: 4.73#Rotatable Bonds: 7Polar Surface Area: 40.80Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 0.63CX LogD: 0.63Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.53Np Likeness Score: 1.02
References 1. Iwasa K, Moriyasu M, Nader B.. (2000) Fungicidal and herbicidal activities of berberine related alkaloids., 64 (9): [PMID:11055412 ] [10.1271/bbb.64.1998 ]