The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Benzyl-1-(4-chloro-2-fluoro-5-iso-propoxycarbonylphenyl)piperazine-2,6-dione ID: ALA2270107
PubChem CID: 76315932
Max Phase: Preclinical
Molecular Formula: C21H20ClFN2O4
Molecular Weight: 418.85
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)OC(=O)c1cc(N2C(=O)CN(Cc3ccccc3)CC2=O)c(F)cc1Cl
Standard InChI: InChI=1S/C21H20ClFN2O4/c1-13(2)29-21(28)15-8-18(17(23)9-16(15)22)25-19(26)11-24(12-20(25)27)10-14-6-4-3-5-7-14/h3-9,13H,10-12H2,1-2H3
Standard InChI Key: AJEVWTQYVBODSU-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
6.8155 -28.6869 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4030 -29.4028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5780 -29.4028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1655 -28.6869 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5780 -27.9711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4030 -27.9711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8155 -30.1145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8155 -27.2553 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6405 -28.6869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0530 -27.9711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8780 -27.9711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2905 -28.6869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8780 -29.4028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0530 -29.4028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2905 -30.1145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8780 -30.8304 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1155 -30.1145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5280 -30.8304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3530 -30.8304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1155 -31.5420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6405 -27.2553 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.1155 -28.6869 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.3405 -28.6869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9280 -29.4028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3405 -30.1145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9280 -30.8304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1031 -30.8304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6906 -30.1145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1031 -29.4028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 6 1 0
2 7 2 0
6 8 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
9 14 2 0
15 16 2 0
18 19 1 0
18 20 1 0
17 18 1 0
15 17 1 0
13 15 1 0
10 21 1 0
12 22 1 0
1 9 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
24 29 2 0
4 23 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 418.85Molecular Weight (Monoisotopic): 418.1096AlogP: 3.42#Rotatable Bonds: 5Polar Surface Area: 66.92Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.46CX LogP: 3.68CX LogD: 3.68Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.55Np Likeness Score: -1.25
References 1. Li B, Xiang D, Hsu CT, Liu ZL, Wu C, Yang HZ.. (2005) A facile synthesis of novel herbicidal 1-phenyl-piperazine-2,6-diones., 10 (9): [PMID:18007377 ] [10.3390/10091119 ]