The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Indanyloxyacetic acid ID: ALA2270132
PubChem CID: 76323265
Max Phase: Preclinical
Molecular Formula: C18H20Cl2O4
Molecular Weight: 371.26
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@]1(C2CCCC2)Cc2cc(OCCC(=O)O)c(Cl)c(Cl)c2C1=O
Standard InChI: InChI=1S/C18H20Cl2O4/c1-18(11-4-2-3-5-11)9-10-8-12(24-7-6-13(21)22)15(19)16(20)14(10)17(18)23/h8,11H,2-7,9H2,1H3,(H,21,22)/t18-/m0/s1
Standard InChI Key: AUTFNONVCZXNFD-SFHVURJKSA-N
Molfile:
RDKit 2D
24 26 0 0 0 0 0 0 0 0999 V2000
29.7930 -2.5960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7919 -3.4197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5041 -3.8327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5023 -2.1871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2150 -2.5924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2153 -3.4151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9981 -3.6720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4832 -3.0054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9976 -2.3392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4998 -1.3658 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
29.0852 -2.1876 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
29.0839 -3.8318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.3724 -3.4185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6602 -3.8307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9487 -3.4174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9486 -2.5965 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.2358 -3.8300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.2499 -1.5578 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.0591 -2.4186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0591 -3.5866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9308 -4.3957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6609 -4.7665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2421 -4.1865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8685 -3.4557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
4 10 1 0
1 11 1 0
2 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
9 18 2 0
8 19 1 1
8 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 20 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 371.26Molecular Weight (Monoisotopic): 370.0739AlogP: 4.78#Rotatable Bonds: 5Polar Surface Area: 63.60Molecular Species: ACIDHBA: 3HBD: 1#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.32CX Basic pKa: ┄CX LogP: 4.86CX LogD: 1.44Aromatic Rings: 1Heavy Atoms: 24QED Weighted: 0.81Np Likeness Score: 0.56
References 1. Boina DR, Lewis EE, Bloomquist JR.. (2008) Nematicidal activity of anion transport blockers against Meloidogyne incognita, Caenorhabditis elegans and Heterorhabditis bacteriophora., 64 (6): [PMID:18407564 ] [10.1002/ps.1591 ]