3-Ethyl-2-methoxy-6-nitro-3,4-dihydro-benzo[e][1,3,2]oxazaphosphinine 2-sulfide

ID: ALA2270186

PubChem CID: 14076329

Max Phase: Preclinical

Molecular Formula: C10H13N2O4PS

Molecular Weight: 288.26

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN1Cc2cc([N+](=O)[O-])ccc2OP1(=S)OC

Standard InChI:  InChI=1S/C10H13N2O4PS/c1-3-11-7-8-6-9(12(13)14)4-5-10(8)16-17(11,18)15-2/h4-6H,3,7H2,1-2H3

Standard InChI Key:  TWERPCDSCWVHLR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 18 19  0  0  0  0  0  0  0  0999 V2000
   22.6571  -19.6786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6559  -20.4981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3640  -20.9071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3622  -19.2697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0708  -19.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0742  -20.5002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7866  -20.9076    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.5001  -20.4943    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   25.4967  -19.6691    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.7798  -19.2572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7085  -21.2800    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   26.3152  -20.4917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.2032  -19.2584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9121  -19.6648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7261  -21.1981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9493  -19.2702    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.2409  -19.6792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.9484  -18.4532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  8 11  2  0
  8 12  1  0
  9 13  1  0
 13 14  1  0
 12 15  1  0
  1 16  1  0
 16 17  2  0
 16 18  1  0
M  CHG  2  16   1  18  -1
M  END

Associated Targets(non-human)

Laodelphax striatellus (278 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Spodoptera litura (1708 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 288.26Molecular Weight (Monoisotopic): 288.0334AlogP: 2.68#Rotatable Bonds: 3
Polar Surface Area: 64.84Molecular Species: HBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.20CX LogD: 2.20
Aromatic Rings: 1Heavy Atoms: 18QED Weighted: 0.48Np Likeness Score: -0.95

References

1. Yoshikawa H, Ueno R.  (1992)  Synthesis and Insecticidal Activity of 2-Alkoxy-4H-l,3,2-benzoxazaphosphorin-2-thiones,  56  (9): [10.1271/bbb.56.1467]

Source