Nimbandiol

ID: ALA2270443

PubChem CID: 76319680

Max Phase: Preclinical

Molecular Formula: C25H30O7

Molecular Weight: 442.51

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)[C@H]1[C@]2(C)C3=C(C)[C@H](c4ccoc4)C[C@@H]3O[C@@H]2[C@H](O)[C@@H]2[C@@]1(C)C(=O)C=C[C@@]2(C)O

Standard InChI:  InChI=1S/C25H30O7/c1-12-14(13-7-9-31-11-13)10-15-17(12)25(4)20(22(28)30-5)24(3)16(26)6-8-23(2,29)19(24)18(27)21(25)32-15/h6-9,11,14-15,18-21,27,29H,10H2,1-5H3/t14-,15+,18-,19+,20-,21-,23-,24-,25+/m1/s1

Standard InChI Key:  QRZJOCOUPAQCQQ-JFDUINIKSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    2.0167   -3.5467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8024   -3.3284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6159   -3.4885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5805   -4.2991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9814   -4.3594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3072   -2.7029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3392   -3.1081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2643   -4.7293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7421   -4.6442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2472   -4.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0620   -2.9814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0266   -3.7941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1400   -4.6690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0703   -3.0479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3745   -2.2726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7374   -2.5324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8284   -4.2326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7875   -3.4282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2207   -5.5649    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5542   -1.5119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7769   -1.7218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4982   -2.8213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6657   -1.8215    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0032   -2.1874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0355   -2.2123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1414   -2.7423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6553   -2.6759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3182   -1.8888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1165   -1.8902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7383   -5.2552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1518   -1.0547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0796   -5.4734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  7  1  0
  4  3  1  1
  5  1  1  0
  6  2  2  0
  7  1  1  0
  8  5  1  0
  5  9  1  6
 10  2  1  0
 11  6  1  0
 10 12  1  6
 13  4  1  0
 14  3  1  0
  7 15  1  1
 11 16  1  6
 17 18  2  0
 18 14  1  0
  8 19  1  6
 20 21  1  0
 21 16  2  0
 22 16  1  0
 23 15  2  0
 24 22  2  0
 25 14  2  0
  1 26  1  1
  3 27  1  6
 28  6  1  0
 13 32  1  6
 29 15  1  0
 30 13  1  0
 31 29  1  0
  4  8  1  0
 10  9  1  0
 12 11  1  0
 13 17  1  0
 20 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA2270443

    NIMBANDIOL

Associated Targets(non-human)

Reticulitermes speratus (161 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 442.51Molecular Weight (Monoisotopic): 442.1992AlogP: 2.53#Rotatable Bonds: 2
Polar Surface Area: 106.20Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.66CX Basic pKa: CX LogP: 1.60CX LogD: 1.60
Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.54Np Likeness Score: 3.00

References

1. Ishida M, Serit M, Nakata K, Raj Juneja L, Kim M, Takahashi S.  (1992)  Several Antifeedants from Neem Oil,Azadirachta indicaA. Juss., againstReticulitermes speratusKolbe (Isoptera: Rhinotermitidae),  56  (11): [10.1271/bbb.56.1835]

Source