The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
deacetylsalannin ID: ALA2270444
Cas Number: 1110-56-1
PubChem CID: 14458886
Max Phase: Preclinical
Molecular Formula: C32H42O8
Molecular Weight: 554.68
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C/C=C(\C)C(=O)O[C@H]1C[C@@H](O)[C@@]2(C)CO[C@H]3[C@H]4O[C@@H]5C[C@@H](c6ccoc6)C(C)=C5[C@@]4(C)[C@H](CC(=O)OC)[C@]1(C)[C@@H]32
Standard InChI: InChI=1S/C32H42O8/c1-8-16(2)29(35)40-23-13-22(33)30(4)15-38-26-27(30)31(23,5)21(12-24(34)36-7)32(6)25-17(3)19(18-9-10-37-14-18)11-20(25)39-28(26)32/h8-10,14,19-23,26-28,33H,11-13,15H2,1-7H3/b16-8+/t19-,20-,21-,22-,23+,26-,27+,28-,30-,31+,32-/m1/s1
Standard InChI Key: MJNRBOGIPLCVIM-LJEOTECVSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
3.8878 -11.9401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6720 -11.7296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4681 -11.8782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4433 -12.6954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8507 -12.7573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1879 -11.0857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7128 -13.0751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1986 -11.5026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1243 -13.1370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6184 -13.0420 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1260 -12.4106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7830 -11.4448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9432 -11.3705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0277 -12.6334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6992 -13.8675 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1185 -10.1654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9102 -12.1877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0648 -11.8163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1296 -13.7973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8242 -10.6276 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6283 -10.9248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2765 -13.0173 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3632 -10.5533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2357 -10.6895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9621 -10.3181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4455 -9.8930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.6655 -10.1076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3960 -11.2096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1556 -9.3275 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8995 -10.5740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6473 -10.7514 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3426 -10.0911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0034 -11.1353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5135 -11.0610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1384 -10.2768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1061 -13.6611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9993 -9.5009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3261 -11.3953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0483 -10.4997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7215 -9.1253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 8 1 0
4 3 1 1
5 1 1 0
6 2 2 0
7 4 1 0
8 1 1 0
9 5 1 0
5 10 1 6
11 2 1 0
12 3 1 0
13 6 1 0
14 18 1 0
9 15 1 6
16 20 1 0
11 17 1 1
18 12 1 0
19 15 1 0
12 20 1 6
13 21 1 6
14 22 1 6
23 16 1 0
8 24 1 1
25 24 1 0
26 27 1 0
27 21 2 0
28 21 1 0
29 16 2 0
30 28 2 0
31 25 2 0
32 23 2 0
1 33 1 1
3 34 1 1
35 6 1 0
7 36 1 1
37 25 1 0
38 23 1 0
39 32 1 0
40 37 1 0
9 4 1 0
10 11 1 0
13 17 1 0
19 7 1 0
14 7 1 0
30 26 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 554.68Molecular Weight (Monoisotopic): 554.2880AlogP: 4.72#Rotatable Bonds: 5Polar Surface Area: 104.43Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.52CX LogD: 3.52Aromatic Rings: 1Heavy Atoms: 40QED Weighted: 0.32Np Likeness Score: 3.45
References 1. Ishida M, Serit M, Nakata K, Raj Juneja L, Kim M, Takahashi S. (1992) Several Antifeedants from Neem Oil,Azadirachta indicaA. Juss., againstReticulitermes speratusKolbe (Isoptera: Rhinotermitidae), 56 (11): [10.1271/bbb.56.1835 ] 2. Suresh G, Gopalakrishnan G, Wesley SD, Pradeep Singh ND, Malathi R, Rajan SS.. (2002) Insect antifeedant activity of tetranortriterpenoids from the Rutales. A perusal of structural relations., 50 (16): [PMID:12137465 ] [10.1021/jf025534t ] 3. Gualtieri MJ, Malafronte N, Vassallo A, Braca A, Cotugno R, Vasaturo M, De Tommasi N, Dal Piaz F.. (2014) Bioactive limonoids from the leaves of Azaridachta indica (Neem)., 77 (3): [PMID:24499352 ] [10.1021/np400863d ]