The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Thaxtomin A ID: ALA2270642
Cas Number: 122380-18-1
PubChem CID: 180098
Product Number: T276425, Order Now?
Max Phase: Preclinical
Molecular Formula: C22H22N4O6
Molecular Weight: 438.44
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN1C(=O)[C@](O)(Cc2cccc(O)c2)N(C)C(=O)[C@@H]1Cc1c[nH]c2cccc([N+](=O)[O-])c12
Standard InChI: InChI=1S/C22H22N4O6/c1-24-18(10-14-12-23-16-7-4-8-17(19(14)16)26(31)32)20(28)25(2)22(30,21(24)29)11-13-5-3-6-15(27)9-13/h3-9,12,18,23,27,30H,10-11H2,1-2H3/t18-,22+/m0/s1
Standard InChI Key: QRDNJYNIEGRRKV-PGRDOPGGSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
0.6589 -5.2003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6578 -6.0198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3658 -6.4288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3641 -4.7914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0727 -5.1967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0729 -6.0153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8516 -6.2681 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3326 -5.6056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8512 -4.9435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3601 -3.9685 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6512 -3.5620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0666 -3.5578 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1034 -4.1662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9027 -3.9961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4492 -4.6096 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2454 -4.4421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5018 -3.6658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9556 -3.0567 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1530 -3.2238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6073 -2.6156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7901 -5.0513 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2155 -3.2672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2271 -2.4501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9437 -2.0516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9571 -1.2398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2543 -0.8190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5376 -1.2192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5290 -2.0337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0794 -4.2428 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1938 -5.3859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2105 -2.2802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6713 -0.8427 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
10 11 2 0
10 12 1 0
4 10 1 0
9 13 1 0
14 13 1 1
14 15 1 0
14 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
16 21 2 0
17 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
17 29 1 6
15 30 1 0
18 31 1 0
25 32 1 0
M CHG 2 10 1 12 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 438.44Molecular Weight (Monoisotopic): 438.1539AlogP: 1.55#Rotatable Bonds: 5Polar Surface Area: 140.01Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.44CX Basic pKa: ┄CX LogP: 2.16CX LogD: 2.15Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.41Np Likeness Score: 0.43
References 1. King RR, Lawrence CH, Gray JA.. (2001) Herbicidal properties of the thaxtomin group of phytotoxins., 49 (5): [PMID:11368592 ] [10.1021/jf0012998 ] 2. Unpublished dataset,