1-Ethoxy(phenyl)thiophosphoryl-4-(2,3,4-tri-O-acetyl-beta-D-xylopyranosyl)thiosemicarbazide

ID: ALA2270684

PubChem CID: 44185050

Max Phase: Preclinical

Molecular Formula: C20H28N3O8PS2

Molecular Weight: 533.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOP(=S)(NNC(=S)N[C@@H]1OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O)c1ccccc1

Standard InChI:  InChI=1S/C20H28N3O8PS2/c1-5-28-32(34,15-9-7-6-8-10-15)23-22-20(33)21-19-18(31-14(4)26)17(30-13(3)25)16(11-27-19)29-12(2)24/h6-10,16-19H,5,11H2,1-4H3,(H,23,34)(H2,21,22,33)/t16-,17+,18-,19-,32?/m1/s1

Standard InChI Key:  BVLMHWCUKNENLI-UHFKPTSJSA-N

Molfile:  

     RDKit          2D

 34 35  0  0  0  0  0  0  0  0999 V2000
   24.8842  -12.1477    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   25.2833  -11.4300    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   24.4623  -11.4433    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.6065  -14.2761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6065  -15.0933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3118  -15.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0171  -15.0933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0171  -14.2761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3118  -13.8634    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.7245  -13.8645    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.7162  -13.0474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0043  -12.6460    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.4197  -12.6316    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   25.9960  -11.8289    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.7242  -15.5029    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.4325  -15.0953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1396  -15.5050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4337  -14.2781    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.3118  -16.3149    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.0195  -16.7235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0195  -17.5407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7272  -16.3149    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.8994  -15.5029    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.1911  -15.0953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4840  -15.5050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1899  -14.2781    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.0423  -10.7422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6926  -10.7233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5076  -10.7275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9170  -10.0212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5093   -9.3119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6879   -9.3135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2821  -10.0204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4394  -10.0280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  5  1  0
  4  9  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  1  1
 10 11  1  0
 11 12  1  0
 11 13  2  0
 12 14  1  0
 14  2  1  0
  7 15  1  6
 15 16  1  0
 16 17  1  0
 16 18  2  0
  6 19  1  1
 19 20  1  0
 20 21  1  0
 20 22  2  0
  5 23  1  6
 23 24  1  0
 24 25  1  0
 24 26  2  0
  3 27  1  0
  2 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 27 34  1  0
M  END

Associated Targets(non-human)

Phomopsis asparagi (62 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Botryosphaeria berengeriana (484 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 533.57Molecular Weight (Monoisotopic): 533.1055AlogP: 0.78#Rotatable Bonds: 9
Polar Surface Area: 133.45Molecular Species: NEUTRALHBA: 10HBD: 3
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.46CX Basic pKa: CX LogP: 1.71CX LogD: 1.71
Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.14Np Likeness Score: 0.25

References

1. Li YX, Wang HA, Yang XP, Cheng HY, Wang ZH, Li YM, Li ZM, Wang SH, Yan DW..  (2009)  Regioselective synthesis of novel 3-alkoxy (phenyl) thiophosphorylamido-2-(per-O-acetylglycosyl-1'-imino)thiazolidine-4-one derivatives from O-alkyl N4-glycosyl(thiosemicarbazido)phosphonothioates.,  344  (10): [PMID:19450796] [10.1016/j.carres.2009.03.027]

Source