The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-Methoxy(phenyl)thiophosphoryl-4-(2,3,4-tri-O-acetyl-beta-D-xylopyranosyl)thiosemicarbazide ID: ALA2270686
PubChem CID: 44185049
Max Phase: Preclinical
Molecular Formula: C19H26N3O8PS2
Molecular Weight: 519.54
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COP(=S)(NNC(=S)N[C@@H]1OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O)c1ccccc1
Standard InChI: InChI=1S/C19H26N3O8PS2/c1-11(23)28-15-10-27-18(17(30-13(3)25)16(15)29-12(2)24)20-19(32)21-22-31(33,26-4)14-8-6-5-7-9-14/h5-9,15-18H,10H2,1-4H3,(H,22,33)(H2,20,21,32)/t15-,16+,17-,18-,31?/m1/s1
Standard InChI Key: CZDNPYXGBMGXKQ-LSXCGXKBSA-N
Molfile:
RDKit 2D
33 34 0 0 0 0 0 0 0 0999 V2000
17.6905 -12.2509 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
18.0895 -11.5332 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
17.2685 -11.5465 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4128 -14.3793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4128 -15.1965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1181 -15.6009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8233 -15.1965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8233 -14.3793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1181 -13.9665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.5307 -13.9677 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5224 -13.1506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8106 -12.7492 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2259 -12.7348 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
18.8023 -11.9320 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5305 -15.6061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2388 -15.1985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9459 -15.6081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2399 -14.3813 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1181 -16.4181 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8258 -16.8267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8258 -17.6439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5335 -16.4181 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7057 -15.6061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9974 -15.1985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2902 -15.6081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9962 -14.3813 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8485 -10.8454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4989 -10.8265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3138 -10.8307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7233 -10.1243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3156 -9.4151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4941 -9.4166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0884 -10.1236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 5 1 0
4 9 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
8 10 1 1
10 11 1 0
11 12 1 0
11 13 2 0
12 14 1 0
14 2 1 0
7 15 1 6
15 16 1 0
16 17 1 0
16 18 2 0
6 19 1 1
19 20 1 0
20 21 1 0
20 22 2 0
5 23 1 6
23 24 1 0
24 25 1 0
24 26 2 0
3 27 1 0
2 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.54Molecular Weight (Monoisotopic): 519.0899AlogP: 0.39#Rotatable Bonds: 8Polar Surface Area: 133.45Molecular Species: NEUTRALHBA: 10HBD: 3#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.46CX Basic pKa: ┄CX LogP: 1.37CX LogD: 1.37Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.14Np Likeness Score: 0.28
References 1. Li YX, Wang HA, Yang XP, Cheng HY, Wang ZH, Li YM, Li ZM, Wang SH, Yan DW.. (2009) Regioselective synthesis of novel 3-alkoxy (phenyl) thiophosphorylamido-2-(per-O-acetylglycosyl-1'-imino)thiazolidine-4-one derivatives from O-alkyl N4-glycosyl(thiosemicarbazido)phosphonothioates., 344 (10): [PMID:19450796 ] [10.1016/j.carres.2009.03.027 ]