The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-Diethoxythiophosphoryl-4-(2,3,4-tri-O-acetyl-beta-D-xylopyranosyl)thiosemicarbazide ID: ALA2270687
PubChem CID: 44185048
Max Phase: Preclinical
Molecular Formula: C16H28N3O9PS2
Molecular Weight: 501.52
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOP(=S)(NNC(=S)N[C@@H]1OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O)OCC
Standard InChI: InChI=1S/C16H28N3O9PS2/c1-6-24-29(31,25-7-2)19-18-16(30)17-15-14(28-11(5)22)13(27-10(4)21)12(8-23-15)26-9(3)20/h12-15H,6-8H2,1-5H3,(H,19,31)(H2,17,18,30)/t12-,13+,14-,15-/m1/s1
Standard InChI Key: XLBBYYQMBWXSCD-LXTVHRRPSA-N
Molfile:
RDKit 2D
31 31 0 0 0 0 0 0 0 0999 V2000
10.2738 -12.2798 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.6729 -11.5621 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
9.8519 -11.5754 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9961 -14.4082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9961 -15.2253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7014 -15.6298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4067 -15.2253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4067 -14.4082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7014 -13.9954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1141 -13.9966 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1058 -13.1795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3940 -12.7781 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8093 -12.7637 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.3857 -11.9609 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6655 -10.7440 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1138 -15.6350 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8221 -15.2274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5292 -15.6370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8233 -14.4102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7014 -16.4470 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4091 -16.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4091 -17.6728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1168 -16.4470 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2890 -15.6350 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5807 -15.2274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8736 -15.6370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5795 -14.4102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4319 -10.8743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3695 -10.3290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8291 -10.1601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3622 -9.5118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 5 1 0
4 9 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
8 10 1 1
10 11 1 0
11 12 1 0
11 13 2 0
12 14 1 0
14 2 1 0
2 15 1 0
7 16 1 6
16 17 1 0
17 18 1 0
17 19 2 0
6 20 1 1
20 21 1 0
21 22 1 0
21 23 2 0
5 24 1 6
24 25 1 0
25 26 1 0
25 27 2 0
3 28 1 0
15 29 1 0
28 30 1 0
29 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.52Molecular Weight (Monoisotopic): 501.1005AlogP: 0.40#Rotatable Bonds: 10Polar Surface Area: 142.68Molecular Species: NEUTRALHBA: 11HBD: 3#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.01CX Basic pKa: ┄CX LogP: 0.49CX LogD: 0.49Aromatic Rings: ┄Heavy Atoms: 31QED Weighted: 0.12Np Likeness Score: 0.43
References 1. Li YX, Wang HA, Yang XP, Cheng HY, Wang ZH, Li YM, Li ZM, Wang SH, Yan DW.. (2009) Regioselective synthesis of novel 3-alkoxy (phenyl) thiophosphorylamido-2-(per-O-acetylglycosyl-1'-imino)thiazolidine-4-one derivatives from O-alkyl N4-glycosyl(thiosemicarbazido)phosphonothioates., 344 (10): [PMID:19450796 ] [10.1016/j.carres.2009.03.027 ]