1-Diethoxythiophosphoryl-4-(2,3,4,6-tetra-O-acetyl-beta-D-galactopyranosyl)thiosemicarbazide

ID: ALA2270690

PubChem CID: 44184993

Max Phase: Preclinical

Molecular Formula: C19H32N3O11PS2

Molecular Weight: 573.58

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCOP(=S)(NNC(=S)N[C@@H]1O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O)OCC

Standard InChI:  InChI=1S/C19H32N3O11PS2/c1-7-28-34(36,29-8-2)22-21-19(35)20-18-17(32-13(6)26)16(31-12(5)25)15(30-11(4)24)14(33-18)9-27-10(3)23/h14-18H,7-9H2,1-6H3,(H,22,36)(H2,20,21,35)/t14-,15+,16+,17-,18-/m1/s1

Standard InChI Key:  BKKJLPUWENANDV-DISONHOPSA-N

Molfile:  

     RDKit          2D

 36 36  0  0  0  0  0  0  0  0999 V2000
   27.0428   -3.1421    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   27.4418   -2.4244    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   26.6208   -2.4377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.7651   -5.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7651   -6.0877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4704   -6.4921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1756   -6.0877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1756   -5.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4704   -4.8577    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.8830   -4.8589    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.8747   -4.0418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1629   -3.6404    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.5782   -3.6260    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   28.1546   -2.8232    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.4345   -1.6063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.8828   -6.4973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.5911   -6.0897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2982   -6.4993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5922   -5.2725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.4704   -7.3093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.1781   -7.7179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1781   -8.5351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8858   -7.3093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.0562   -4.8640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0538   -4.0468    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.3449   -3.6402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3425   -2.8231    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.6384   -4.0509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0580   -6.4973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.3497   -6.0897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6425   -6.4993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3485   -5.2725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.2008   -1.7366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3838   -1.7498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1385   -1.1913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1311   -0.3770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  5  1  0
  4  9  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  1  1
 10 11  1  0
 11 12  1  0
 11 13  2  0
 12 14  1  0
 14  2  1  0
  2 15  1  0
  7 16  1  6
 16 17  1  0
 17 18  1  0
 17 19  2  0
  6 20  1  1
 20 21  1  0
 21 22  1  0
 21 23  2  0
  4 24  1  1
 24 25  1  0
 25 26  1  0
 26 27  2  0
 26 28  1  0
  5 29  1  1
 29 30  1  0
 30 31  1  0
 30 32  2  0
  3 33  1  0
 33 34  1  0
 15 35  1  0
 35 36  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA2270690

   [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[(diethoxyphosphinothioylamino)carbamothioylamino]oxan-2-yl]methyl acetate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 573.58

Molecular Weight (Monoisotopic): 573.1216

AlogP: 0.34

#Rotatable Bonds: 12

Polar Surface Area: 168.98

Molecular Species: NEUTRAL

HBA: 13

HBD: 3

#RO5 Violations: 2

HBA (Lipinski): 14

HBD (Lipinski): 3

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 11.01

CX Basic pKa: ┄

CX LogP: 0.31

CX LogD: 0.31

Aromatic Rings: ┄

Heavy Atoms: 36

QED Weighted: 0.10

Np Likeness Score: 0.58

References

1. Li YX, Wang HA, Yang XP, Cheng HY, Wang ZH, Li YM, Li ZM, Wang SH, Yan DW..  (2009)  Regioselective synthesis of novel 3-alkoxy (phenyl) thiophosphorylamido-2-(per-O-acetylglycosyl-1'-imino)thiazolidine-4-one derivatives from O-alkyl N4-glycosyl(thiosemicarbazido)phosphonothioates.,  344  (10): [PMID:19450796] [10.1016/j.carres.2009.03.027]

Source

Source(1):

• Scientific Literature