The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
benzo[d][1,3]dioxol-5-yl(diethoxyphosphoryl)methyl 2-(3-(trifluoromethyl)phenoxy)acetate ID: ALA2270888
PubChem CID: 76315980
Max Phase: Preclinical
Molecular Formula: C21H22F3O8P
Molecular Weight: 490.37
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOP(=O)(OCC)C(OC(=O)COc1cccc(C(F)(F)F)c1)c1ccc2c(c1)OCO2
Standard InChI: InChI=1S/C21H22F3O8P/c1-3-30-33(26,31-4-2)20(14-8-9-17-18(10-14)29-13-28-17)32-19(25)12-27-16-7-5-6-15(11-16)21(22,23)24/h5-11,20H,3-4,12-13H2,1-2H3
Standard InChI Key: UUZKFCHVBZMKNG-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
29.5881 -10.2231 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
29.1754 -10.9289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.9877 -10.9278 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.9283 -10.2437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9271 -11.0633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6352 -11.4722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3448 -11.0628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3420 -10.2401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6334 -9.8349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0482 -9.8289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7574 -10.2348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4636 -9.8236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1728 -10.2295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.4605 -9.0064 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8790 -9.8182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8759 -9.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2939 -9.8112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.8049 -10.9341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5800 -11.6389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2204 -9.8353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2203 -9.0181 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22.5128 -10.2441 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22.5099 -9.4266 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.5821 -8.5950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1611 -7.7875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1673 -8.6026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8696 -7.3718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5774 -7.7739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1785 -7.2249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.8422 -6.4836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0333 -6.5744 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.2080 -11.6449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1675 -12.3443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 1 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
15 1 1 0
15 16 1 0
1 17 2 0
3 18 1 0
2 19 1 0
4 20 1 0
20 21 1 0
20 22 1 0
20 23 1 0
16 24 2 0
24 28 1 0
27 25 1 0
25 26 2 0
26 16 1 0
27 28 2 0
28 29 1 0
29 30 1 0
30 31 1 0
31 27 1 0
18 32 1 0
19 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 490.37Molecular Weight (Monoisotopic): 490.1004AlogP: 5.32#Rotatable Bonds: 10Polar Surface Area: 89.52Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.44CX LogD: 4.44Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.33Np Likeness Score: -0.66
References 1. He H, Chen T, Li Y. (2007) Synthesis and herbicidal activity of alkyl 1-(3-trifluoromethylphenoxyacetoxy)-1-substituted methylphosphonates, 32 (1): [10.1584/jpestics.G06-05 ]